CAS RN 946387-07-1
CAS RN 946387-07-1
RN 1734, TRC
CAS: 946387-07-1 Formula molecolare: C14H22Cl2N2O2S Molecular Weight (g/mol): 353.31 Sinonimo: RN 1734,2,4-Dichloro-N-isopropyl-N-(2-isopropylaminoethyl)benzenesulfonamide IUPAC Name: 2,4-dichloro-N-propan-2-yl-N-[2-(propan-2-ylamino)ethyl]benzenesulfonamide SMILES: CC(C)NCCN(C(C)C)S(=O)(=O)c1ccc(Cl)cc1Cl
RN-1734, MedChemExpress
MedChemExpress RN-1734 is selective antagonist of the TRPV4 channel, completely antagonizes 4αPDD-mediated activation of TRPV4 with comparable, low micromolar IC50s for all three species (hTRPV4: 2.3 μM, mTRPV4: 5.9 μM, rTRPV4: 3.2 μM). RN-1734 clearly decreases the production of tumor necrosis factor α (TNF-α) and interleukin 1β (IL-1β) without altering the number of olig2-positive cells.