Learn More
Alfa Aesar™ 1,4-Dichloro-2-nitrobenzene, 98%
Marca: Alfa Aesar™ A11896.30
Dettagli aggiuntivi : CAS : 89-61-2 Peso : 0.25000kg Transport : UN number : 3077 Chem class : 9 Pack group : III
| Quantità | 250g |
|---|
Descrizione
Applications1,4-Dichloro-2-nitrobenzene is a reagent used in the synthesis of antitrypanosomal, antileishmanial and antimalarial agents. It is also used in the synthesis of lysophosphatidic acid acyltransferase-β in hibitors.
Solubility
Soluble in water, ethanol, ether, benzene, carbon disulfide. Slightly soluble in carbon tetrachloride.
Notes
Incompatible with strong oxidizing agents, strong bases.
Identificatori chimici
| 89-61-2 | |
| 191.995 | |
| RZKKOBGFCAHLCZ-UHFFFAOYSA-N | |
| 6977 | |
| C1=CC(=C(C=C1Cl)[N+](=O)[O-])Cl |
| C6H3Cl2NO2 | |
| MFCD00007074 | |
| 2,5-dichloronitrobenzene, nitro-p-dichlorobenzene, benzene, 1,4-dichloro-2-nitro, 1-nitro-2,5-dichlorobenzene, 2,5-dichlornitrobenzen, 2,5-dichloro-1-nitrobenzene, benzene, 2,5-dichloronitro, 2,5-dichloronitrobenzol, unii-iy18g50ff4, ccris 3096 | |
| 1,4-dichloro-2-nitrobenzene |
Specifica
| 1,4-Dichloro-2-nitrobenzene | |
| 125°C (257°F) | |
| 53°C to 57°C | |
| 89-61-2 | |
| MFCD00007074 | |
| 778109 | |
| Soluble in water,ethanol,ether,benzene,carbon disulfide. Slightly soluble in carbon tetrachloride. | |
| C1=CC(=C(C=C1Cl)[N+](=O)[O-])Cl | |
| 191.995 | |
| 192 |
| 1.6 | |
| 266°C to 269°C | |
| 250g | |
| C6H3Cl2NO2 | |
| UN3077 | |
| 2,5-dichloronitrobenzene, nitro-p-dichlorobenzene, benzene, 1,4-dichloro-2-nitro, 1-nitro-2,5-dichlorobenzene, 2,5-dichlornitrobenzen, 2,5-dichloro-1-nitrobenzene, benzene, 2,5-dichloronitro, 2,5-dichloronitrobenzol, unii-iy18g50ff4, ccris 3096 | |
| RZKKOBGFCAHLCZ-UHFFFAOYSA-N | |
| 1,4-dichloro-2-nitrobenzene | |
| 6977 | |
| 98% |