Learn More
Alfa Aesar™ 4-Amino-3,5-diiodobenzoic acid, tech. 90%
Marca: Alfa Aesar™ A10617.06
Dettagli aggiuntivi : CAS : 2122-61-4 Peso : 0.00500kg
| Quantità | 5g |
|---|
Descrizione
Applications4-Amino-3,5-diiodobenzoic acid is a very useful substituted benzene compound for use as a building block in synthesis. The carboxylic acid and amine functionalities can be used to form linkages through nucleophile-electrophile coupling and the iodides may be used as functional sites for cross-coupling transformations. 4-Amino-3,5-diiodobenzoic acid has been specifically used in the synthesis of an adduct to introduce into Tecoflex polymers to impart radiopaqueness to the material.
Solubility
Soluble in water (partly miscible).
Notes
Store at room temperature. Store in cool place. Keep container tightly closed in a dry and well-ventilated place. Keep away from strong oxidizing agents. Stable under normal temperatures and pressures.
Identificatori chimici
| 2122-61-4 | |
| 388.931 | |
| WXTVPMWCUMEVSZ-UHFFFAOYSA-N | |
| 16460 | |
| C1=C(C=C(C(=C1I)N)I)C(=O)O |
| C7H5I2NO2 | |
| MFCD00007684 | |
| benzoic acid, 4-amino-3,5-diiodo, 3,5-dijod-4-aminohippursaeure, 3,5-diiodo-4-aminobenzoic acid, 3,5-dijod-4-aminohippursaeure german, 4-amino-3,5-diiodo-benzoicacid, pubchem4681, acmc-1cq3z, wln: zr bi fi dvq, labotest-bb lt00080707, 4-amino-3,5-diiodo-benzoicaci | |
| 4-amino-3,5-diiodobenzoic acid |
Specifica
| 4-Amino-3,5-diiodobenzoic acid | |
| >300°C | |
| 2122-61-4 | |
| MFCD00007684 | |
| benzoic acid, 4-amino-3,5-diiodo, 3,5-dijod-4-aminohippursaeure, 3,5-diiodo-4-aminobenzoic acid, 3,5-dijod-4-aminohippursaeure german, 4-amino-3,5-diiodo-benzoicacid, pubchem4681, acmc-1cq3z, wln: zr bi fi dvq, labotest-bb lt00080707, 4-amino-3,5-diiodo-benzoicaci | |
| WXTVPMWCUMEVSZ-UHFFFAOYSA-N | |
| 4-amino-3,5-diiodobenzoic acid | |
| 16460 | |
| 90% |
| Light sensitive | |
| 5g | |
| C7H5I2NO2 | |
| 2103037 | |
| Soluble in water (partly miscible). | |
| C1=C(C=C(C(=C1I)N)I)C(=O)O | |
| 388.931 | |
| 388.93 | |
| Technical |