Learn More
Alfa Aesar™ 4-Cyano-2-fluorobenzoic acid, 98%
Marca: Alfa Aesar™ L19722.06
Dettagli aggiuntivi : CAS : 164149-28-4 Peso : 0.00500kg Transport : UN number : 3439 Chem class : 6.1 Pack group : III
| Quantità | 5g |
|---|
Descrizione
Applications4-Cyano-2-fluorobenzoic acid is an important raw material and intermediate used in organic synthesis, pharmaceuticals agrochemicals and dyestuff fields.
Solubility
Insoluble in water.
Notes
Keep the container tightly sealed. Store in a cool, dry conditions in well sealed containers. Incompatible with oxidizing agents.
Identificatori chimici
| 164149-28-4 | |
| 165.123 | |
| KEJMSTJTAWACNI-UHFFFAOYSA-N | |
| 590659 | |
| C1=CC(=C(C=C1C#N)F)C(=O)O |
| C8H4FNO2 | |
| MFCD03094454 | |
| 2-fluoro-4-cyanobenzoic acid, benzoic acid, 4-cyano-2-fluoro, 4-cyano-2-fluoro-benzoic acid, 4-cyano-2-fluorobenzoicacid, pubchem4603, acmc-1bzbk, intermediates-zcf02232, 2-fluoro4-cyanobenzoic acid, ksc489o1d, 4-carboxy-3-fluorobenzonitrile | |
| 4-cyano-2-fluorobenzoic acid |
Specifica
| 4-Cyano-2-fluorobenzoic acid | |
| 5g | |
| C8H4FNO2 | |
| 8051929 | |
| Insoluble in water. | |
| C1=CC(=C(C=C1C#N)F)C(=O)O | |
| 165.123 | |
| 165.12 |
| 214°C to 218°C | |
| 164149-28-4 | |
| MFCD03094454 | |
| 2-fluoro-4-cyanobenzoic acid, benzoic acid, 4-cyano-2-fluoro, 4-cyano-2-fluoro-benzoic acid, 4-cyano-2-fluorobenzoicacid, pubchem4603, acmc-1bzbk, intermediates-zcf02232, 2-fluoro4-cyanobenzoic acid, ksc489o1d, 4-carboxy-3-fluorobenzonitrile | |
| KEJMSTJTAWACNI-UHFFFAOYSA-N | |
| 4-cyano-2-fluorobenzoic acid | |
| 590659 | |
| 98% |