Learn More
Clotrimazole, Thermo Scientific™
Specific inhibitor of calcium-activated potassium channels
Marca: Thermo Scientific Alfa Aesar J63895.14
| Quantità | 25g |
|---|
Descrizione
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
ApplicationsClotrimazole is an imidazole derivative and an antifungal compound and a CYP (cytochrome P450) inhibitor. Clotrimazole has been shown to block the intermediate-conductance, IK1 channels (Ca2+ activated K+ channels), in cells such as erythrocytes. In vitro studies of various yeast strains have demonstrated susceptibility to clotrimazole. Clotrimazole is an activator of MB67 and an inhibitor of CYP3A4 and CYP51A1.
Solubility
Soluble in chloroform, DMSO, DMF and alcohols
Notes
Store at room temperature. Incompatible with oxidizing agents.
Identificatori chimici
| 23593-75-1 | |
| 344.842 | |
| VNFPBHJOKIVQEB-UHFFFAOYSA-N | |
| 2812 | |
| 1-[(2-chlorophenyl)-diphenylmethyl]imidazole |
| C22H17ClN2 | |
| MFCD00057220 | |
| 1-[(2-Chlorophenyl)diphenylmethyl]-1H-imidazole; 1-(o-Chlorotrityl)imidazole | |
| CHEBI:3764 | |
| C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3Cl)N4C=CN=C4 |
Specifica
| Clotrimazole | |
| White | |
| C22H17ClN2 | |
| 14,2417 | |
| Soluble in chloroform, DMSO, DMF and alcohols | |
| C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3Cl)N4C=CN=C4 | |
| 344.842 | |
| CHEBI:3764 |
| 23593-75-1 | |
| 25g | |
| MFCD00057220 | |
| 1-[(2-Chlorophenyl)diphenylmethyl]-1H-imidazole; 1-(o-Chlorotrityl)imidazole | |
| VNFPBHJOKIVQEB-UHFFFAOYSA-N | |
| 1-[(2-chlorophenyl)-diphenylmethyl]imidazole | |
| 2812 | |
| 344.84 |
Facendo clic su Invia, l'utente riconosce che potrebbe essere contattato da Fisher Scientific in merito al feedback fornito in questo modulo. Non condivideremo le vostre informazioni per altri scopi. Tutte le informazioni di contatto fornite saranno conservate in conformità con la nostra Politica sulla privacy. Informativa sulla privacy.