Learn More
Alfa Aesar™ Isatin, 98%
Marca: Alfa Aesar™ A12468.36
Dettagli aggiuntivi : CAS : 91-56-5 Peso : 0.50000kg
Quantità | 500g |
---|
Descrizione
ApplicationsIsatin is an endogenous monoamine oxidize (MAO) inhibitor involved in stress and anxiety. Additionally, isatin inhibits alkaline phosphatase (ALP), nitric oxide (NO)-stimulated soluble guanylate cyclase, and other enzymes. Isatins undergo a one-pot Wolff-Kishner like reduction with hydrazine hydrate, under surprisingly mild conditions, to give the corresponding oxindoles. It is used as chromatographic spray reagent for amino acid detection.
Solubility
Soluble in water (1.9 g/L at 20°C).
Notes
Store under cool dry place. Ensure good ventilation. Incompatible with oxidizing agents.
Identificatori chimici
91-56-5 | |
147.133 | |
JXDYKVIHCLTXOP-UHFFFAOYSA-N | |
7054 | |
1H-indole-2,3-dione |
C8H5NO2 | |
MFCD00005718 | |
isatin, indoline-2,3-dione, 2,3-indolinedione, indole-2,3-dione, isatine, 2,3-dioxoindoline, pseudoisatin, tribulin, isotin, isatic acid lactam | |
CHEBI:27539 | |
C1=CC=C2C(=C1)C(=O)C(=O)N2 |
Specifica
Isatin | |
Odorless | |
500g | |
91-56-5 | |
MFCD00005718 | |
14,5104 | |
Soluble in water (1.9g/L at 20°C). | |
C1=CC=C2C(=C1)C(=O)C(=O)N2 | |
147.133 | |
CHEBI:27539 | |
98% |
220°C (428°F) | |
~199°C to 200°C | |
7 | |
C8H5NO2 | |
383659 | |
isatin, indoline-2,3-dione, 2,3-indolinedione, indole-2,3-dione, isatine, 2,3-dioxoindoline, pseudoisatin, tribulin, isotin, isatic acid lactam | |
JXDYKVIHCLTXOP-UHFFFAOYSA-N | |
1H-indole-2,3-dione | |
7054 | |
147.13 |