Learn More
L-(+)-Ascorbic acid, ACS, >99%, Alfa Aesar™
Marca: Alfa Aesar 036237.14
Dettagli aggiuntivi : CAS : 50-81-7 Peso : 0.02500kg
| Quantità | 25g |
|---|
Identificatori chimici
| 50-81-7 | |
| 176.124 | |
| CIWBSHSKHKDKBQ-JLAZNSOCSA-N | |
| 54670067 | |
| (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one |
| C6H8O6 | |
| MFCD00064328 | |
| l-ascorbic acid, ascorbic acid, vitamin c, l-ascorbate, ascorbate, ascorbicap, l +-ascorbic acid, cevitamic acid, ascoltin, hybrin | |
| CHEBI:29073 | |
| C(C(C1C(=C(C(=O)O1)O)O)O)O |
Specifica
| L-Ascorbic acid | |
| ∽191°C (decomposition) | |
| For analysis ACS | |
| >99+% | |
| MFCD00064328 | |
| l-ascorbic acid, ascorbic acid, vitamin c, l-ascorbate, ascorbate, ascorbicap, l +-ascorbic acid, cevitamic acid, ascoltin, hybrin | |
| CIWBSHSKHKDKBQ-JLAZNSOCSA-N | |
| (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one | |
| 54670067 | |
| 176.12 | |
| ACS Reagent |
| 1.65 g/mL | |
| 25g | |
| 50-81-7 | |
| C6H8O6 | |
| 84272 | |
| Soluble in water. Insoluble in ether,chloroform,benzene,petroleum ether,oils,fats and fat solvents. L-ascorbic acid means that the compound′s stereochemistry is related to that of the levorotatory enantiomer of glyceraldehyde. | |
| C(C(C1C(=C(C(=O)O1)O)O)O)O | |
| 176.124 | |
| CHEBI:29073 | |
| Powder |