missing translation for 'onlineSavingsMsg'
Learn More
Learn More
4,4'-Dimethoxybenzil, 99+%, Thermo Scientific Chemicals
40.40€ - 145.00€
Identificatori chimici
| CAS | 1226-42-2 |
|---|---|
| Formula molecolare | C16H14O4 |
| Molecular Weight (g/mol) | 270.27 |
| Numero MDL | MFCD00008405 |
| InChI Key | YNANGXWUZWWFKX-UHFFFAOYSA-N |
| Sinonimo | 4,4'-dimethoxybenzil, anisil, p-anisil, 1,2-bis 4-methoxyphenyl ethane-1,2-dione, bis 4-methoxyphenyl ethanedione, ethanedione, bis 4-methoxyphenyl, di-p-anisoyl, p,p'-dimethoxybenzil, 1,2-ethanedione, 1,2-bis 4-methoxyphenyl, 1,2-bis 4-methoxyphenyl-1,2-ethanedione |
| PubChem CID | 71043 |
| IUPAC Name | 1,2-bis(4-methoxyphenyl)ethane-1,2-dione |
| SMILES | COC1=CC=C(C=C1)C(=O)C(=O)C2=CC=C(C=C2)OC |
| Codice del prodotto | Marca | Quantità | Imballaggio | Prezzo | Quantità e disponibilità | ||||
|---|---|---|---|---|---|---|---|---|---|
| Codice del prodotto | Marca | Quantità | Imballaggio | Prezzo | Quantità e disponibilità | ||||
|
10012120
|
Thermo Scientific Acros
170450050 |
5 g | Glass bottle |
40.40€
5g |
Effettua il login per acquistare questo articolo Hai bisogno di un conto web ? Registrati oggi stesso! | ||||
|
10675992
|
Thermo Scientific Acros
170450250 |
25 g | Glass bottle |
145.00€
25g |
Effettua il login per acquistare questo articolo Hai bisogno di un conto web ? Registrati oggi stesso! | ||||
Descrizione
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Identificatori chimici
| 1226-42-2 | |
| 270.27 | |
| YNANGXWUZWWFKX-UHFFFAOYSA-N | |
| 71043 | |
| COC1=CC=C(C=C1)C(=O)C(=O)C2=CC=C(C=C2)OC |
| C16H14O4 | |
| MFCD00008405 | |
| 4,4'-dimethoxybenzil, anisil, p-anisil, 1,2-bis 4-methoxyphenyl ethane-1,2-dione, bis 4-methoxyphenyl ethanedione, ethanedione, bis 4-methoxyphenyl, di-p-anisoyl, p,p'-dimethoxybenzil, 1,2-ethanedione, 1,2-bis 4-methoxyphenyl, 1,2-bis 4-methoxyphenyl-1,2-ethanedione | |
| 1,2-bis(4-methoxyphenyl)ethane-1,2-dione |
Specifica
| 4, 4'-Dimethoxybenzil | |
| 1226-42-2 | |
| 100.0 | |
| Yellow | |
| 99+% | |
| CH3OC6H4COCOC6H4OCH3 | |
| 08, 428 | |
| YNANGXWUZWWFKX-UHFFFAOYSA-N | |
| 1,2-bis(4-methoxyphenyl)ethane-1,2-dione | |
| 71043 | |
| 99+% |
| 99+% | |
| 99.0 | |
| 131.0°C to 134.0°C | |
| Authentic | |
| C16H14O4 | |
| MFCD00008405 | |
| 4,4'-dimethoxybenzil, anisil, p-anisil, 1,2-bis 4-methoxyphenyl ethane-1,2-dione, bis 4-methoxyphenyl ethanedione, ethanedione, bis 4-methoxyphenyl, di-p-anisoyl, p,p'-dimethoxybenzil, 1,2-ethanedione, 1,2-bis 4-methoxyphenyl, 1,2-bis 4-methoxyphenyl-1,2-ethanedione | |
| COC1=CC=C(C=C1)C(=O)C(=O)C2=CC=C(C=C2)OC | |
| 270.27 | |
| 270.27 | |
| Fine Crystalline Powder |
Sicurezza e movimentazione
missing translation for 'einecsNumber' : 214-960-5
missing translation for 'tsca' : TSCA
RUO – Research Use Only