Learn More
Ethylenediaminetetraacetic Acid (0.5M Solution/pH 8.0), Fisher BioReagents
Marca: Fisher Bioreagents BP2482-20
Dettagli aggiuntivi : CAS : 60-00-4 Peso : 20.05000kg
Quantità | 20L |
---|---|
Imballaggio | Poly CUBE |
Descrizione
EDTA is used extensively in molecular biology to minimize metal ion impurities in reaction buffers. Ideal for DNA work.Identificatori chimici
60-00-4 | |
292.24 | |
KCXVZYZYPLLWCC-UHFFFAOYSA-N | |
6049 | |
2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid |
C10H16N2O8 | |
MFCD00003541 | |
edta, edetic acid, ethylenediaminetetraacetic acid, edathamil, versene, endrate, havidote, titriplex, edta acid, sequestrol | |
CHEBI:42191 | |
OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
Specifica
Ethylenediamine Tetraacetic Acid | |
60-00-4,7732-18-5 | |
(HOOCCH2)2NCH2CH2N(CH2COOH)2 | |
0.475 to 0.525M | |
edta, edetic acid, ethylenediaminetetraacetic acid, edathamil, versene, endrate, havidote, titriplex, edta acid, sequestrol | |
OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O | |
2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid | |
6049 | |
292.25 | |
Pass Test | |
Protease free | |
8.0 |
0.5 M Solution, pH 8.0 (for DNA Work) | |
C10H16N2O8 | |
MFCD00003541 | |
15, 3565 | |
KCXVZYZYPLLWCC-UHFFFAOYSA-N | |
DNase free | |
292.24 | |
CHEBI:42191 | |
Liquid | |
Poly CUBE | |
Colorless | |
20L |
Sicurezza e movimentazione
- Ethylenediaminetetraacetic Acid (0.5M Solution/pH 8.0)
Avvertenza
- Attenzione
Categoria di pericolo
- Lesione oculare grave/irritazione oculare Categoria 2
- Tossicità specifica per organi bersaglio (esposizione ripetuta) Categoria 2
Indicazioni di pericolo
- H373-Può provocare danni agli organi.
- H319-Provoca grave irritazione oculare.
Consigli di prudenza
- P264-Lavare accuratamente dopo l'uso.
- P280-Indossare guanti/indumenti protettivi/Proteggere gli occhi/il viso.
- P305+P351+P338-IN CASO DI CONTATTO CON GLI OCCHI: sciacquare accuratamente per parecchi minuti. Togliere le eventuali lenti a contatto se è agevole farlo. Continuare a sciacquare.
- P337+P313-Se l'irritazione degli occhi persiste, consultare un medico.