Learn More
Finasteride, Thermo Scientific™
Inhibitor of steroid 5-a-reductase
Marca: Thermo Scientific Alfa Aesar J63454.03
| Quantità | 1g |
|---|
Descrizione
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
ApplicationsFinasteride is used as a inhibitor of steroid 5-a-reductase, antiandrogen, an intracellular enzyme that converts the androgen testosterone into 5α dihydrotestosterone.
Solubility
Soluble in water, DMSO, ethanol, methanol, and chloroform.
Notes
Protect from heat. Store away from oxidizing agents.
Identificatori chimici
| 98319-26-7 | |
| 372.553 | |
| DBEPLOCGEIEOCV-WSBQPABSSA-N | |
| 57363 | |
| (1S,3aS,3bS,5aR,9aR,9bS,11aS)-N-tert-butyl-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinoline-1-carboxamide |
| C23H36N2O2 | |
| MFCD00869737 | |
| finasteride, proscar, propecia, finastid, prostide, chibro-proscar, finasterida, finasteridum, finpecia, finasteridum inn-latin | |
| CHEBI:5062 | |
| CC12CCC3C(C1CCC2C(=O)NC(C)(C)C)CCC4C3(C=CC(=O)N4)C |
Specifica
| Finasteride | |
| C23H36N2O2 | |
| 1g | |
| finasteride, proscar, propecia, finastid, prostide, chibro-proscar, finasterida, finasteridum, finpecia, finasteridum inn-latin | |
| DBEPLOCGEIEOCV-WSBQPABSSA-N | |
| (1S,3aS,3bS,5aR,9aR,9bS,11aS)-N-tert-butyl-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinoline-1-carboxamide | |
| 57363 | |
| 372.54 |
| 98319-26-7 | |
| MFCD00869737 | |
| 14,4082 | |
| Soluble in water,DMSO,ethanol,methanol,and chloroform. | |
| CC12CCC3C(C1CCC2C(=O)NC(C)(C)C)CCC4C3(C=CC(=O)N4)C | |
| 372.553 | |
| CHEBI:5062 |
Facendo clic su Invia, l'utente riconosce che potrebbe essere contattato da Fisher Scientific in merito al feedback fornito in questo modulo. Non condivideremo le vostre informazioni per altri scopi. Tutte le informazioni di contatto fornite saranno conservate in conformità con la nostra Politica sulla privacy. Informativa sulla privacy.