Learn More
Irinotecan hydrochloride, Thermo Scientific™
Topoisomerase I inhibitor
Marca: Thermo Scientific Alfa Aesar J60743.MD
| Quantità | 250mg |
|---|
Descrizione
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Identificatori chimici
| 100286-90-6 | |
| 623.15 | |
| GURKHSYORGJETM-WAQYZQTGSA-N | |
| 74990 | |
| hydrogen (19S)-10,19-diethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.0²,¹¹.0⁴,⁹.0¹⁵,²⁰]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl [1,4'-bipiperidine]-1'-carboxylate chloride |
| C33H39ClN4O6 | |
| MFCD01862255 | |
| irinotecan hydrochloride, irinotecan hcl, topotecin, campto, cpt-11, cpt 11, camptothecin 11 hydrochloride, camptothecin 11, unii-06x131e4oe | |
| CHEBI:5971 | |
| [H+].[Cl-].CCC1=C2C=C(OC(=O)N3CCC(CC3)N3CCCCC3)C=CC2=NC2=C1CN1C2=CC2=C(COC(=O)[C@]2(O)CC)C1=O |
Specifica
| Irinotecan hydrochloride | |
| C33H39ClN4O6 | |
| 250mg | |
| irinotecan hydrochloride, irinotecan hcl, topotecin, campto, cpt-11, cpt 11, camptothecin 11 hydrochloride, camptothecin 11, unii-06x131e4oe | |
| GURKHSYORGJETM-WAQYZQTGSA-N | |
| hydrogen (19S)-10,19-diethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.0²,¹¹.0⁴,⁹.0¹⁵,²⁰]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl [1,4'-bipiperidine]-1'-carboxylate chloride | |
| 74990 | |
| 623.14 |
| 100286-90-6 | |
| MFCD01862255 | |
| 14,5091 | |
| Soluble in DMSO or DMF at approximately 20mg/ml; Sparingly soluble in aqueous buffers; /n | |
| [H+].[Cl-].CCC1=C2C=C(OC(=O)N3CCC(CC3)N3CCCCC3)C=CC2=NC2=C1CN1C2=CC2=C(COC(=O)[C@]2(O)CC)C1=O | |
| 623.15 | |
| CHEBI:5971 |
Facendo clic su Invia, l'utente riconosce che potrebbe essere contattato da Fisher Scientific in merito al feedback fornito in questo modulo. Non condivideremo le vostre informazioni per altri scopi. Tutte le informazioni di contatto fornite saranno conservate in conformità con la nostra Politica sulla privacy. Informativa sulla privacy.