Learn More
Milrinone, 98+%, Thermo Scientific™
Potent cAMP-specific phosphodiesterase inhibitor
Marca: Thermo Scientific Alfa Aesar J62659.MF
| Quantità | 50mg |
|---|
vedi altre versioni di questo prodotto
Descrizione
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
ApplicationsIt is used (particularly intravenously, as the lactate) for the short-term management of severe heart failure. Milrinone inhibits the action of phosphodiesterase-3 preventing degradation of cAMP. The corresponding increase in cAMP levels leads to increased activation of protein kinase A. It is a selective phosphodiesterase inhibitor with vasodilating and positive inotropic activity.
Solubility
Soluble in DMSO. Insoluble in water.
Notes
Store away from oxidizing agents. Keep the container tightly closed and place it in a cool, dry and well ventilated condition.
Identificatori chimici
| 78415-72-2 | |
| 211.224 | |
| PZRHRDRVRGEVNW-UHFFFAOYSA-N | |
| 4197 | |
| 6-methyl-2-oxo-5-pyridin-4-yl-1H-pyridine-3-carbonitrile |
| C12H9N3O | |
| MFCD00133539 | |
| milrinone, primacor, corotrope, corotrop, milrinona, milrinonum, milrinonum latin, milrinona spanish, milrila, unii-ju9yax04c7 | |
| CHEBI:50693 | |
| CC1=C(C=C(C(=O)N1)C#N)C2=CC=NC=C2 |
Specifica
| Milrinone | |
| C12H9N3O | |
| 50mg | |
| 14,6197 | |
| Soluble in DMSO; Insoluble in water. | |
| CC1=C(C=C(C(=O)N1)C#N)C2=CC=NC=C2 | |
| 211.224 | |
| CHEBI:50693 | |
| ≥98% |
| 78415-72-2 | |
| MFCD00133539 | |
| UN2811 | |
| milrinone, primacor, corotrope, corotrop, milrinona, milrinonum, milrinonum latin, milrinona spanish, milrila, unii-ju9yax04c7 | |
| PZRHRDRVRGEVNW-UHFFFAOYSA-N | |
| 6-methyl-2-oxo-5-pyridin-4-yl-1H-pyridine-3-carbonitrile | |
| 4197 | |
| 211.22 |
Proporcione sus comentarios sobre el contenido del producto rellenando el siguiente formulario.