Learn More
Omeprazole, 98%, Thermo Scientific™
A proton pump inhibitor
Marca: Thermo Scientific Alfa Aesar J62860.03
| Quantità | 1g |
|---|
Descrizione
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
ApplicationsOmeprazole also acts as an aryl hydrocarbon-like inducer of cytochrome P450 secretion in human liver. This compound is an inhibitor a variety of CYP isoenzymes, including CYP2C19, CYP2C9 and CYP3A.
Solubility
Soluble in water (0.5 mg/ml), DMSO (25 mg/ml), and ethanol (4.5 mg/ml).
Notes
Store in cool place. Keep container tightly closed in a dry and well-ventilated place. Recommended storage temperature: -20°C. Keep away from strong oxidizing agents.
Identificatori chimici
| 73590-58-6 | |
| 345.417 | |
| SUBDBMMJDZJVOS-UHFFFAOYSA-N | |
| 4594 | |
| 6-methoxy-2-[(4-methoxy-3,5-dimethylpyridin-2-yl)methylsulfinyl]-1H-benzimidazole |
| C17H19N3O3S | |
| MFCD00083192 | |
| omeprazole, losec, prilosec, antra, esomeprazole, omeprazon, audazol, omapren, omepral, parizac | |
| CHEBI:77260 | |
| CC1=CN=C(C(=C1OC)C)CS(=O)C2=NC3=C(N2)C=C(C=C3)OC |
Specifica
| Omeprazole | |
| C17H19N3O3S | |
| 1g | |
| omeprazole, losec, prilosec, antra, esomeprazole, omeprazon, audazol, omapren, omepral, parizac | |
| SUBDBMMJDZJVOS-UHFFFAOYSA-N | |
| 6-methoxy-2-[(4-methoxy-3,5-dimethylpyridin-2-yl)methylsulfinyl]-1H-benzimidazole | |
| 4594 | |
| 345.42 |
| 73590-58-6 | |
| MFCD00083192 | |
| 14,6845 | |
| Soluble in water (0.5mg/ml),DMSO (25mg/ml),and ethanol (4.5mg/ml). | |
| CC1=CN=C(C(=C1OC)C)CS(=O)C2=NC3=C(N2)C=C(C=C3)OC | |
| 345.417 | |
| CHEBI:77260 | |
| 98% |
Fornite il vostro feedback sul contenuto del prodotto compilando il modulo sottostante.