Learn More
Tamsulosin hydrochloride, 98+%, Thermo Scientific™
An alpha-1 adrenoceptor antagonist
Marca: Thermo Scientific Alfa Aesar J61999.MA
| Quantità | 10mg |
|---|
Descrizione
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Identificatori chimici
| 106463-17-6 | |
| 444.971 | |
| ZZIZZTHXZRDOFM-XFULWGLBSA-N | |
| 5362376 | |
| 5-[(2R)-2-[2-(2-ethoxyphenoxy)ethylamino]propyl]-2-methoxybenzenesulfonamide;hydrochloride |
| C20H29ClN2O5S | |
| MFCD00922997 | |
| tamsulosin hydrochloride, omnic, tamsulosin hcl, pradif, flomax, urolosin, secotex, josir, alna, omic | |
| CHEBI:9399 | |
| CCOC1=CC=CC=C1OCCNC(C)CC2=CC(=C(C=C2)OC)S(=O)(=O)N.Cl |
Specifica
| Tamsulosin hydrochloride | |
| C20H29ClN2O5S | |
| 10mg | |
| tamsulosin hydrochloride, omnic, tamsulosin hcl, pradif, flomax, urolosin, secotex, josir, alna, omic | |
| CCOC1=CC=CC=C1OCCNC(C)CC2=CC(=C(C=C2)OC)S(=O)(=O)N.Cl | |
| 444.971 | |
| CHEBI:9399 | |
| ≥98% |
| 106463-17-6 | |
| MFCD00922997 | |
| 14,9049 | |
| ZZIZZTHXZRDOFM-XFULWGLBSA-N | |
| 5-[(2R)-2-[2-(2-ethoxyphenoxy)ethylamino]propyl]-2-methoxybenzenesulfonamide;hydrochloride | |
| 5362376 | |
| 444.97 |
Fornite il vostro feedback sul contenuto del prodotto compilando il modulo sottostante.