Risultati della ricerca filtrata
Sand, washed
CAS: 14808-60-7 Formula molecolare: O2Si Molecular Weight (g/mol): 60.08 Numero MDL: MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 InChI Key: VYPSYNLAJGMNEJ-UHFFFAOYSA-N Sinonimo: silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous PubChem CID: 24261 ChEBI: CHEBI:30563 IUPAC Name: dioxosilane SMILES: O=[Si]=O
Gli ordini eseguiti prima delle 14:00 saranno spediti oggi stesso. Gli ordini eseguiti dopo le 14:00 saranno spediti domani.
Per saperne di più
| Sinonimo | silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous |
|---|---|
| Numero MDL | MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 |
| PubChem CID | 24261 |
| Formula molecolare | O2Si |
| CAS | 14808-60-7 |
| Molecular Weight (g/mol) | 60.08 |
| ChEBI | CHEBI:30563 |
| SMILES | O=[Si]=O |
| IUPAC Name | dioxosilane |
| InChI Key | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
Silicon carbide powder, medium, 120 grit
CAS: 409-21-2 Formula molecolare: CSi Molecular Weight (g/mol): 40.10 Numero MDL: MFCD00049531 InChI Key: HBMJWWWQQXIZIP-UHFFFAOYSA-N Sinonimo: silicon carbide,carborundum,silicon monocarbide,carborundeum,tokawhisker,betarundum,carbolon,nicalon,silundum,carbon silicide PubChem CID: 9863 ChEBI: CHEBI:29390 SMILES: [C-]#[Si+]
Gli ordini eseguiti prima delle 14:00 saranno spediti oggi stesso. Gli ordini eseguiti dopo le 14:00 saranno spediti domani.
Per saperne di più
| Sinonimo | silicon carbide,carborundum,silicon monocarbide,carborundeum,tokawhisker,betarundum,carbolon,nicalon,silundum,carbon silicide |
|---|---|
| Numero MDL | MFCD00049531 |
| PubChem CID | 9863 |
| Formula molecolare | CSi |
| CAS | 409-21-2 |
| Molecular Weight (g/mol) | 40.10 |
| ChEBI | CHEBI:29390 |
| SMILES | [C-]#[Si+] |
| InChI Key | HBMJWWWQQXIZIP-UHFFFAOYSA-N |
Zeolite Y, sodium
CAS: 1318-02-1 Formula molecolare: Al2O5Si Molecular Weight (g/mol): 162.043 Numero MDL: MFCD00132601 InChI Key: HNPSIPDUKPIQMN-UHFFFAOYSA-N Sinonimo: kaolinite,montmorillonite aluminum pillared clay,silica-alumina catalyst support, grade 135,aidplusocma,bactekillermb,fiberfrax™,bactekillerbm101a,bactekillerbm102a,bactekillerbm501a,kaolinite, natural PubChem CID: 9942228 IUPAC Name: dioxosilane;oxo(oxoalumanyloxy)alumane SMILES: O=[Al]O[Al]=O.O=[Si]=O
Gli ordini eseguiti prima delle 14:00 saranno spediti oggi stesso. Gli ordini eseguiti dopo le 14:00 saranno spediti domani.
Per saperne di più
| Sinonimo | kaolinite,montmorillonite aluminum pillared clay,silica-alumina catalyst support, grade 135,aidplusocma,bactekillermb,fiberfrax™,bactekillerbm101a,bactekillerbm102a,bactekillerbm501a,kaolinite, natural |
|---|---|
| Numero MDL | MFCD00132601 |
| PubChem CID | 9942228 |
| Formula molecolare | Al2O5Si |
| CAS | 1318-02-1 |
| Molecular Weight (g/mol) | 162.043 |
| SMILES | O=[Al]O[Al]=O.O=[Si]=O |
| IUPAC Name | dioxosilane;oxo(oxoalumanyloxy)alumane |
| InChI Key | HNPSIPDUKPIQMN-UHFFFAOYSA-N |
Silicone oil, high temperature, usable temperature range: 25 to 250°C (open system) and 25 to 315°C (closed system)
CAS: 68083-14-7 Formula molecolare: C16H22O2Si2 Molecular Weight (g/mol): 302.52 Numero MDL: MFCD00132673 InChI Key: ARWRSWALIGRKQA-UHFFFAOYSA-N Sinonimo: diphenyl-dimethylsiloxane copolymer,polydimethyl-diphenylsiloxane, viscosity 400cst. PubChem CID: 121233058 IUPAC Name: methoxy-dimethyl-[methyl(diphenyl)silyl]oxysilane SMILES: CO[Si](C)(C)O[Si](C)(C1=CC=CC=C1)C2=CC=CC=C2
Gli ordini eseguiti prima delle 14:00 saranno spediti oggi stesso. Gli ordini eseguiti dopo le 14:00 saranno spediti domani.
Per saperne di più
| Sinonimo | diphenyl-dimethylsiloxane copolymer,polydimethyl-diphenylsiloxane, viscosity 400cst. |
|---|---|
| Numero MDL | MFCD00132673 |
| PubChem CID | 121233058 |
| Formula molecolare | C16H22O2Si2 |
| CAS | 68083-14-7 |
| Molecular Weight (g/mol) | 302.52 |
| SMILES | CO[Si](C)(C)O[Si](C)(C1=CC=CC=C1)C2=CC=CC=C2 |
| IUPAC Name | methoxy-dimethyl-[methyl(diphenyl)silyl]oxysilane |
| InChI Key | ARWRSWALIGRKQA-UHFFFAOYSA-N |
Silicon carbide powder, coarse, 46 grit
CAS: 409-21-2 Formula molecolare: CSi Molecular Weight (g/mol): 40.10 Numero MDL: MFCD00049531 InChI Key: HBMJWWWQQXIZIP-UHFFFAOYSA-N Sinonimo: silicon carbide,carborundum,silicon monocarbide,carborundeum,tokawhisker,betarundum,carbolon,nicalon,silundum,carbon silicide PubChem CID: 9863 ChEBI: CHEBI:29390 SMILES: [C-]#[Si+]
Gli ordini eseguiti prima delle 14:00 saranno spediti oggi stesso. Gli ordini eseguiti dopo le 14:00 saranno spediti domani.
Per saperne di più
| Sinonimo | silicon carbide,carborundum,silicon monocarbide,carborundeum,tokawhisker,betarundum,carbolon,nicalon,silundum,carbon silicide |
|---|---|
| Numero MDL | MFCD00049531 |
| PubChem CID | 9863 |
| Formula molecolare | CSi |
| CAS | 409-21-2 |
| Molecular Weight (g/mol) | 40.10 |
| ChEBI | CHEBI:29390 |
| SMILES | [C-]#[Si+] |
| InChI Key | HBMJWWWQQXIZIP-UHFFFAOYSA-N |
1H,1H,2H,2H-Perfluorooctyltrichlorosilane, 97%
CAS: 78560-45-9 Formula molecolare: C8H4Cl3F13Si Molecular Weight (g/mol): 481.534 Numero MDL: MFCD00042363 InChI Key: PISDRBMXQBSCIP-UHFFFAOYSA-N Sinonimo: trichloro 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl silane,1h,1h,2h,2h-perfluorooctyltrichlorosilane,silane, trichloro 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl,tridecafluoro-1,1,2,2-tetrahydrooctyl trichlorosilane,trichloro 1h,1h,2h,2h-perfluorooctyl silane,2-tridecafluorohexyl ethyltrichlorosilane,1h,1h,2h,2h-perfluorooctyl trichlorosilane,trichloro 1h,1h,2h,2h-perfluoro-n-octyl silane,trichloro 1h,1h,2h,2h-tridecafluoro-n-octyl silane PubChem CID: 123578 IUPAC Name: trichloro(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane SMILES: C(C[Si](Cl)(Cl)Cl)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F
| Sinonimo | trichloro 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl silane,1h,1h,2h,2h-perfluorooctyltrichlorosilane,silane, trichloro 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl,tridecafluoro-1,1,2,2-tetrahydrooctyl trichlorosilane,trichloro 1h,1h,2h,2h-perfluorooctyl silane,2-tridecafluorohexyl ethyltrichlorosilane,1h,1h,2h,2h-perfluorooctyl trichlorosilane,trichloro 1h,1h,2h,2h-perfluoro-n-octyl silane,trichloro 1h,1h,2h,2h-tridecafluoro-n-octyl silane |
|---|---|
| Numero MDL | MFCD00042363 |
| PubChem CID | 123578 |
| Formula molecolare | C8H4Cl3F13Si |
| CAS | 78560-45-9 |
| Molecular Weight (g/mol) | 481.534 |
| SMILES | C(C[Si](Cl)(Cl)Cl)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
| IUPAC Name | trichloro(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane |
| InChI Key | PISDRBMXQBSCIP-UHFFFAOYSA-N |
(3-Glycidoxypropyl)trimethoxysilane, 97%
CAS: 2530-83-8 Formula molecolare: C9H20O5Si Molecular Weight (g/mol): 236.339 Numero MDL: MFCD00005144 InChI Key: BPSIOYPQMFLKFR-UHFFFAOYSA-N Sinonimo: 3-glycidoxypropyltrimethoxysilane,3-glycidoxypropyl trimethoxysilane,glymo,silicone kbm 403,silane a 187,union carbide a-187,silan a 187,silane z 6040,silane-y-4087,3-glycidyloxypropyltrimethoxysilane PubChem CID: 17317 IUPAC Name: trimethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane SMILES: CO[Si](CCCOCC1CO1)(OC)OC
| Sinonimo | 3-glycidoxypropyltrimethoxysilane,3-glycidoxypropyl trimethoxysilane,glymo,silicone kbm 403,silane a 187,union carbide a-187,silan a 187,silane z 6040,silane-y-4087,3-glycidyloxypropyltrimethoxysilane |
|---|---|
| Numero MDL | MFCD00005144 |
| PubChem CID | 17317 |
| Formula molecolare | C9H20O5Si |
| CAS | 2530-83-8 |
| Molecular Weight (g/mol) | 236.339 |
| SMILES | CO[Si](CCCOCC1CO1)(OC)OC |
| IUPAC Name | trimethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane |
| InChI Key | BPSIOYPQMFLKFR-UHFFFAOYSA-N |
(3-Aminopropyl)triethoxysilane, 98%
CAS: 919-30-2 Formula molecolare: C9H23NO3Si Molecular Weight (g/mol): 221.37 Numero MDL: MFCD00008207,MFCD01324904 InChI Key: WYTZZXDRDKSJID-UHFFFAOYSA-N Sinonimo: 3-aminopropyltriethoxysilane,3-aminopropyl triethoxysilane,aptes,3-triethoxysilyl propan-1-amine,1-propanamine, 3-triethoxysilyl,silicone a-1100,silane 1100,3-triethoxysilyl propylamine,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane PubChem CID: 13521 IUPAC Name: 3-triethoxysilylpropan-1-amine SMILES: CCO[Si](CCCN)(OCC)OCC
| Sinonimo | 3-aminopropyltriethoxysilane,3-aminopropyl triethoxysilane,aptes,3-triethoxysilyl propan-1-amine,1-propanamine, 3-triethoxysilyl,silicone a-1100,silane 1100,3-triethoxysilyl propylamine,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane |
|---|---|
| Numero MDL | MFCD00008207,MFCD01324904 |
| PubChem CID | 13521 |
| Formula molecolare | C9H23NO3Si |
| CAS | 919-30-2 |
| Molecular Weight (g/mol) | 221.37 |
| SMILES | CCO[Si](CCCN)(OCC)OCC |
| IUPAC Name | 3-triethoxysilylpropan-1-amine |
| InChI Key | WYTZZXDRDKSJID-UHFFFAOYSA-N |
Hexamethyldisilazane, Electronic grade, 99+%
CAS: 999-97-3 Formula molecolare: C6H19NSi2 Numero MDL: MFCD00008259 InChI Key: FFUAGWLWBBFQJT-UHFFFAOYSA-N Sinonimo: hexamethyldisilazane,bis trimethylsilyl amine,hmds,1,1,1,3,3,3-hexamethyldisilazane,hexamethylsilazane,silanamine, 1,1,1-trimethyl-n-trimethylsilyl,tri-sil,1,1,1-trimethyl-n-trimethylsilyl silanamine,hexamethyldisilizane,disilazane, 1,1,1,3,3,3-hexamethyl PubChem CID: 13838 ChEBI: CHEBI:85068 IUPAC Name: [dimethyl-(trimethylsilylamino)silyl]methane SMILES: C[Si](C)(C)N[Si](C)(C)C
| Sinonimo | hexamethyldisilazane,bis trimethylsilyl amine,hmds,1,1,1,3,3,3-hexamethyldisilazane,hexamethylsilazane,silanamine, 1,1,1-trimethyl-n-trimethylsilyl,tri-sil,1,1,1-trimethyl-n-trimethylsilyl silanamine,hexamethyldisilizane,disilazane, 1,1,1,3,3,3-hexamethyl |
|---|---|
| Numero MDL | MFCD00008259 |
| PubChem CID | 13838 |
| Formula molecolare | C6H19NSi2 |
| CAS | 999-97-3 |
| ChEBI | CHEBI:85068 |
| SMILES | C[Si](C)(C)N[Si](C)(C)C |
| IUPAC Name | [dimethyl-(trimethylsilylamino)silyl]methane |
| InChI Key | FFUAGWLWBBFQJT-UHFFFAOYSA-N |
Methyltrimethoxysilane, 97%
CAS: 1185-55-3 Formula molecolare: C4H12O3Si Molecular Weight (g/mol): 136.222 Numero MDL: MFCD00008342 InChI Key: BFXIKLCIZHOAAZ-UHFFFAOYSA-N Sinonimo: methyltrimethoxysilane,trimethoxy methyl silane,silane, trimethoxymethyl,union carbide a-163,silane, methyltrimethoxy,methyl trimethoxysilane,silane a-163,dynasylan mtms,unii-0hi0d71mci,methyl-trimethoxysilane PubChem CID: 14456 IUPAC Name: trimethoxy(methyl)silane SMILES: CO[Si](C)(OC)OC
| Sinonimo | methyltrimethoxysilane,trimethoxy methyl silane,silane, trimethoxymethyl,union carbide a-163,silane, methyltrimethoxy,methyl trimethoxysilane,silane a-163,dynasylan mtms,unii-0hi0d71mci,methyl-trimethoxysilane |
|---|---|
| Numero MDL | MFCD00008342 |
| PubChem CID | 14456 |
| Formula molecolare | C4H12O3Si |
| CAS | 1185-55-3 |
| Molecular Weight (g/mol) | 136.222 |
| SMILES | CO[Si](C)(OC)OC |
| IUPAC Name | trimethoxy(methyl)silane |
| InChI Key | BFXIKLCIZHOAAZ-UHFFFAOYSA-N |
Trimethylsilyl cyanide, 97%
CAS: 7677-24-9 Formula molecolare: C4H9NSi Molecular Weight (g/mol): 99.21 Numero MDL: MFCD00001765 InChI Key: LEIMLDGFXIOXMT-UHFFFAOYSA-N Sinonimo: trimethylsilyl cyanide,cyanotrimethylsilane,trimethylsilanecarbonitrile,trimethylsilylcyanide,silanecarbonitrile, trimethyl,trimethylsilylnitrile,tmscn,trimethyl silane cyanide,trimethylsilylcarbonitrile,tms cyanide PubChem CID: 82115 IUPAC Name: trimethylsilylformonitrile SMILES: C[Si](C)(C)C#N
| Sinonimo | trimethylsilyl cyanide,cyanotrimethylsilane,trimethylsilanecarbonitrile,trimethylsilylcyanide,silanecarbonitrile, trimethyl,trimethylsilylnitrile,tmscn,trimethyl silane cyanide,trimethylsilylcarbonitrile,tms cyanide |
|---|---|
| Numero MDL | MFCD00001765 |
| PubChem CID | 82115 |
| Formula molecolare | C4H9NSi |
| CAS | 7677-24-9 |
| Molecular Weight (g/mol) | 99.21 |
| SMILES | C[Si](C)(C)C#N |
| IUPAC Name | trimethylsilylformonitrile |
| InChI Key | LEIMLDGFXIOXMT-UHFFFAOYSA-N |
Trimethylsilyl cyanide, 98%
CAS: 7677-24-9 Formula molecolare: C4H9NSi Molecular Weight (g/mol): 99.21 Numero MDL: MFCD00001765 InChI Key: LEIMLDGFXIOXMT-UHFFFAOYSA-N Sinonimo: trimethylsilyl cyanide,cyanotrimethylsilane,trimethylsilanecarbonitrile,trimethylsilylcyanide,silanecarbonitrile, trimethyl,trimethylsilylnitrile,tmscn,trimethyl silane cyanide,trimethylsilylcarbonitrile,tms cyanide PubChem CID: 82115 IUPAC Name: trimethylsilylformonitrile SMILES: C[Si](C)(C)C#N
| Sinonimo | trimethylsilyl cyanide,cyanotrimethylsilane,trimethylsilanecarbonitrile,trimethylsilylcyanide,silanecarbonitrile, trimethyl,trimethylsilylnitrile,tmscn,trimethyl silane cyanide,trimethylsilylcarbonitrile,tms cyanide |
|---|---|
| Numero MDL | MFCD00001765 |
| PubChem CID | 82115 |
| Formula molecolare | C4H9NSi |
| CAS | 7677-24-9 |
| Molecular Weight (g/mol) | 99.21 |
| SMILES | C[Si](C)(C)C#N |
| IUPAC Name | trimethylsilylformonitrile |
| InChI Key | LEIMLDGFXIOXMT-UHFFFAOYSA-N |
Phenylsilane, 97%
CAS: 694-53-1 Formula molecolare: C6 H8 Si Molecular Weight (g/mol): 108.22 Numero MDL: MFCD00013478 InChI Key: XJWOWXZSFTXJEX-UHFFFAOYSA-N Sinonimo: phenylsilane,benzene, silyl,silylbenzene,silane, phenyl,fenylsilan,fenylsilan czech,phenylsilane, silyl,silane, phenyl-, PubChem CID: 6327628 IUPAC Name: phenylsilicon SMILES: C1=CC=C(C=C1)[Si]
| Sinonimo | phenylsilane,benzene, silyl,silylbenzene,silane, phenyl,fenylsilan,fenylsilan czech,phenylsilane, silyl,silane, phenyl-, |
|---|---|
| Numero MDL | MFCD00013478 |
| PubChem CID | 6327628 |
| Formula molecolare | C6 H8 Si |
| CAS | 694-53-1 |
| Molecular Weight (g/mol) | 108.22 |
| SMILES | C1=CC=C(C=C1)[Si] |
| IUPAC Name | phenylsilicon |
| InChI Key | XJWOWXZSFTXJEX-UHFFFAOYSA-N |
Triethylsilane, 99%
CAS: 617-86-7 Formula molecolare: C6H16Si Molecular Weight (g/mol): 116.28 InChI Key: QXTIBZLKQPJVII-UHFFFAOYSA-N Sinonimo: triethylsilane,hydride,silane, triethyl,triethylhydrosilane,triethylsilyl,silane e3h,c6h16si,triethylsilyl radical,silane, triethyl-,,triethylsilane tes PubChem CID: 6327258 IUPAC Name: triethylsilicon SMILES: CC[Si](CC)CC
| Sinonimo | triethylsilane,hydride,silane, triethyl,triethylhydrosilane,triethylsilyl,silane e3h,c6h16si,triethylsilyl radical,silane, triethyl-,,triethylsilane tes |
|---|---|
| PubChem CID | 6327258 |
| Formula molecolare | C6H16Si |
| CAS | 617-86-7 |
| Molecular Weight (g/mol) | 116.28 |
| SMILES | CC[Si](CC)CC |
| IUPAC Name | triethylsilicon |
| InChI Key | QXTIBZLKQPJVII-UHFFFAOYSA-N |
- Precedente
- 1
- 2
- 3
- 4
- Successivo