missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Bicine, 99+%, for biochemistry
40.50€ - 323.00€
Identificatori chimici
| CAS | 150-25-4 |
|---|---|
| Formula molecolare | C6H12NNaO4 |
| Molecular Weight (g/mol) | 185.16 |
| Numero MDL | MFCD00004295 |
| InChI Key | MFBDBXAVPLFMNJ-UHFFFAOYSA-M |
| Sinonimo | N, N-Bis(2-hydroxyethyl)glycine, Diethylolglycine |
| PubChem CID | 8761 |
| ChEBI | CHEBI:40957 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]acetic acid |
| SMILES | [Na+].OCCN(CCO)CC([O-])=O |
| Codice del prodotto | Marca | Quantità | Imballaggio | Prezzo | Quantità e disponibilità | ||||
|---|---|---|---|---|---|---|---|---|---|
| Codice del prodotto | Marca | Quantità | Imballaggio | Prezzo | Quantità e disponibilità | ||||
|
10129512
|
Thermo Scientific Chemicals
327710250 |
25 g | Plastic bottle |
40.50€
25g |
Effettua il login per acquistare questo articolo Hai bisogno di un conto web ? Registrati oggi stesso! | ||||
|
10153441
|
Thermo Scientific Chemicals
327711000 |
100 g | Plastic bottle |
106.00€
100g |
Effettua il login per acquistare questo articolo Hai bisogno di un conto web ? Registrati oggi stesso! | ||||
|
10331104
|
Thermo Scientific Chemicals
327715000 |
500 g | Plastic bottle |
323.00€
500g |
Effettua il login per acquistare questo articolo Hai bisogno di un conto web ? Registrati oggi stesso! | ||||
Descrizione
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Biological bufferIdentificatori chimici
| 150-25-4 | |
| 185.16 | |
| MFBDBXAVPLFMNJ-UHFFFAOYSA-M | |
| 8761 | |
| 2-[bis(2-hydroxyethyl)amino]acetic acid |
| C6H12NNaO4 | |
| MFCD00004295 | |
| N, N-Bis(2-hydroxyethyl)glycine, Diethylolglycine | |
| CHEBI:40957 | |
| [Na+].OCCN(CCO)CC([O-])=O |
Specifica
| 0.05 max. (0.5M, water) at 260nm, 0.05 max. (0.5M, water) at 280nm | |
| For biochemistry | |
| 190.0°C to 192.0°C | |
| 100.0 | |
| Powder | |
| Authentic | |
| (HOCH2CH2)2NCH2CO2H | |
| N, N-Bis(2-hydroxyethyl)glycine, Diethylolglycine | |
| MFBDBXAVPLFMNJ-UHFFFAOYSA-M | |
| 2-[bis(2-hydroxyethyl)amino]acetic acid | |
| 8761 | |
| 163.17 | |
| Biochemical |
| Bicine | |
| 150-25-4 | |
| 99.0 | |
| White | |
| 99+% | |
| C6H12NNaO4 | |
| MFCD00004295 | |
| Solubility in water: soluble. Other solubilities: slightly soluble in ethanol, ether, chloroform and, benzene | |
| [Na+].OCCN(CCO)CC([O-])=O | |
| 185.16 | |
| CHEBI:40957 | |
| ≥99% |
RUO – Research Use Only