Alkyl Halides
Risultati della ricerca filtrata
Dichloromethane, anhydrous, 99.7+%, packaged under Argon in resealable ChemSeal™ bottles, stab. with amylene
CAS: 75-09-2 Formula molecolare: CH2Cl2 Molecular Weight (g/mol): 84.93 Numero MDL: MFCD00000881 InChI Key: YMWUJEATGCHHMB-UHFFFAOYSA-N Sinonimo: methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm PubChem CID: 6344 ChEBI: CHEBI:15767 IUPAC Name: diclorometano SMILES: ClCCl
| Sinonimo | methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm |
|---|---|
| Numero MDL | MFCD00000881 |
| PubChem CID | 6344 |
| Formula molecolare | CH2Cl2 |
| CAS | 75-09-2 |
| Molecular Weight (g/mol) | 84.93 |
| ChEBI | CHEBI:15767 |
| SMILES | ClCCl |
| IUPAC Name | diclorometano |
| InChI Key | YMWUJEATGCHHMB-UHFFFAOYSA-N |
1-Bromobutane, 99%
CAS: 109-65-9 Formula molecolare: C4H9Br Molecular Weight (g/mol): 137.02 Numero MDL: MFCD00000260 InChI Key: MPPPKRYCTPRNTB-UHFFFAOYSA-N Sinonimo: butyl bromide,n-butyl bromide,bromobutane,butane, 1-bromo,1-butyl bromide,butane, bromo,n-butylbromide,1-bromo-butane,unii-sav6y78u3d,ccris 831 PubChem CID: 8002 IUPAC Name: 1-bromobutane SMILES: CCCCBr
| Sinonimo | butyl bromide,n-butyl bromide,bromobutane,butane, 1-bromo,1-butyl bromide,butane, bromo,n-butylbromide,1-bromo-butane,unii-sav6y78u3d,ccris 831 |
|---|---|
| Numero MDL | MFCD00000260 |
| PubChem CID | 8002 |
| Formula molecolare | C4H9Br |
| CAS | 109-65-9 |
| Molecular Weight (g/mol) | 137.02 |
| SMILES | CCCCBr |
| IUPAC Name | 1-bromobutane |
| InChI Key | MPPPKRYCTPRNTB-UHFFFAOYSA-N |
Heptafluorobutyric acid, 99%
CAS: 375-22-4 Formula molecolare: C4HF7O2 Molecular Weight (g/mol): 214.039 Numero MDL: MFCD00004171 InChI Key: YPJUNDFVDDCYIH-UHFFFAOYSA-N Sinonimo: heptafluorobutyric acid,perfluorobutyric acid,heptafluorobutanoic acid,perfluorobutanoic acid,butanoic acid, heptafluoro,heptafluoro-1-butanoic acid,perfluoropropanecarboxylic acid,butyric acid, heptafluoro,kyselina heptafluormaselna,kyselina heptafluormaselna czech PubChem CID: 9777 ChEBI: CHEBI:39426 IUPAC Name: 2,2,3,3,4,4,4-heptafluorobutanoic acid SMILES: C(=O)(C(C(C(F)(F)F)(F)F)(F)F)O
| Sinonimo | heptafluorobutyric acid,perfluorobutyric acid,heptafluorobutanoic acid,perfluorobutanoic acid,butanoic acid, heptafluoro,heptafluoro-1-butanoic acid,perfluoropropanecarboxylic acid,butyric acid, heptafluoro,kyselina heptafluormaselna,kyselina heptafluormaselna czech |
|---|---|
| Numero MDL | MFCD00004171 |
| PubChem CID | 9777 |
| Formula molecolare | C4HF7O2 |
| CAS | 375-22-4 |
| Molecular Weight (g/mol) | 214.039 |
| ChEBI | CHEBI:39426 |
| SMILES | C(=O)(C(C(C(F)(F)F)(F)F)(F)F)O |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutanoic acid |
| InChI Key | YPJUNDFVDDCYIH-UHFFFAOYSA-N |
1,2-Dibromoethane, 99%
CAS: 106-93-4 Formula molecolare: C2H4Br2 Molecular Weight (g/mol): 187.86 InChI Key: PAAZPARNPHGIKF-UHFFFAOYSA-N Sinonimo: ethylene dibromide,ethylene bromide,sym-dibromoethane,ethane, 1,2-dibromo,alpha,beta-dibromoethane,bromuro di etile,1,2-dibromaethan,1,2-dibroomethaan,1,2-ethylene dibromide,aadibroom PubChem CID: 7839 ChEBI: CHEBI:28534 IUPAC Name: 1,2-dibromoethane SMILES: C(CBr)Br
| Sinonimo | ethylene dibromide,ethylene bromide,sym-dibromoethane,ethane, 1,2-dibromo,alpha,beta-dibromoethane,bromuro di etile,1,2-dibromaethan,1,2-dibroomethaan,1,2-ethylene dibromide,aadibroom |
|---|---|
| PubChem CID | 7839 |
| Formula molecolare | C2H4Br2 |
| CAS | 106-93-4 |
| Molecular Weight (g/mol) | 187.86 |
| ChEBI | CHEBI:28534 |
| SMILES | C(CBr)Br |
| IUPAC Name | 1,2-dibromoethane |
| InChI Key | PAAZPARNPHGIKF-UHFFFAOYSA-N |
Diiodomethane, 99%, stab.
CAS: 75-11-6 Formula molecolare: CH2I2 Molecular Weight (g/mol): 267.84 Numero MDL: MFCD00001079 InChI Key: NZZFYRREKKOMAT-UHFFFAOYSA-N Sinonimo: methylene iodide,methane, diiodo,methylene diiodide,mi-gee,dijodmethan,methylenjodid,dijodmethan czech,methylenjodid czech,di-iodomethane,diiodo-methane PubChem CID: 6346 IUPAC Name: diiodomethane SMILES: ICI
Gli ordini eseguiti prima delle 14:00 saranno spediti oggi stesso. Gli ordini eseguiti dopo le 14:00 saranno spediti domani.
Per saperne di più
| Sinonimo | methylene iodide,methane, diiodo,methylene diiodide,mi-gee,dijodmethan,methylenjodid,dijodmethan czech,methylenjodid czech,di-iodomethane,diiodo-methane |
|---|---|
| Numero MDL | MFCD00001079 |
| PubChem CID | 6346 |
| Formula molecolare | CH2I2 |
| CAS | 75-11-6 |
| Molecular Weight (g/mol) | 267.84 |
| SMILES | ICI |
| IUPAC Name | diiodomethane |
| InChI Key | NZZFYRREKKOMAT-UHFFFAOYSA-N |
Diiodomethane, 99+%, stabilized with silver wire
CAS: 75-11-6 Formula molecolare: CH2I2 Molecular Weight (g/mol): 267.84 Numero MDL: MFCD00001079 InChI Key: NZZFYRREKKOMAT-UHFFFAOYSA-N Sinonimo: methylene iodide,methane, diiodo,methylene diiodide,mi-gee,dijodmethan,methylenjodid,dijodmethan czech,methylenjodid czech,di-iodomethane,diiodo-methane PubChem CID: 6346 IUPAC Name: diiodomethane SMILES: ICI
Gli ordini eseguiti prima delle 14:00 saranno spediti oggi stesso. Gli ordini eseguiti dopo le 14:00 saranno spediti domani.
Per saperne di più
| Sinonimo | methylene iodide,methane, diiodo,methylene diiodide,mi-gee,dijodmethan,methylenjodid,dijodmethan czech,methylenjodid czech,di-iodomethane,diiodo-methane |
|---|---|
| Numero MDL | MFCD00001079 |
| PubChem CID | 6346 |
| Formula molecolare | CH2I2 |
| CAS | 75-11-6 |
| Molecular Weight (g/mol) | 267.84 |
| SMILES | ICI |
| IUPAC Name | diiodomethane |
| InChI Key | NZZFYRREKKOMAT-UHFFFAOYSA-N |
1H,1H,2H,2H-Perfluorooctanol, 97%
CAS: 647-42-7 Formula molecolare: C8H5F13O Molecular Weight (g/mol): 364.106 Numero MDL: MFCD00042143 InChI Key: GRJRKPMIRMSBNK-UHFFFAOYSA-N Sinonimo: 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-octanol,2-perfluorohexyl ethanol,1h,1h,2h,2h-perfluorooctan-1-ol,1h,1h,2h,2h-perfluorooctanol,1h,1h,2h,2h-perfluoro-1-octanol,unii-g2r5yo5n3v,1-octanol, 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro,1h,1h,2h,2h-tridecafluoro-1-n-octanol,g2r5yo5n3v,1,1,2,2-tetrahydroperfluoro-1-octanol PubChem CID: 69537 IUPAC Name: 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctan-1-ol SMILES: C(CO)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F
Gli ordini eseguiti prima delle 14:00 saranno spediti oggi stesso. Gli ordini eseguiti dopo le 14:00 saranno spediti domani.
Per saperne di più
| Sinonimo | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-octanol,2-perfluorohexyl ethanol,1h,1h,2h,2h-perfluorooctan-1-ol,1h,1h,2h,2h-perfluorooctanol,1h,1h,2h,2h-perfluoro-1-octanol,unii-g2r5yo5n3v,1-octanol, 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro,1h,1h,2h,2h-tridecafluoro-1-n-octanol,g2r5yo5n3v,1,1,2,2-tetrahydroperfluoro-1-octanol |
|---|---|
| Numero MDL | MFCD00042143 |
| PubChem CID | 69537 |
| Formula molecolare | C8H5F13O |
| CAS | 647-42-7 |
| Molecular Weight (g/mol) | 364.106 |
| SMILES | C(CO)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctan-1-ol |
| InChI Key | GRJRKPMIRMSBNK-UHFFFAOYSA-N |
Iodoform, 99+%
CAS: 75-47-8 Formula molecolare: CHI3 Molecular Weight (g/mol): 393.72 Numero MDL: MFCD00001069 InChI Key: OKJPEAGHQZHRQV-UHFFFAOYSA-N Sinonimo: triiodomethane,methane, triiodo,carbon triiodide,jodoform,trijodmethane,dezinfekt v,jodoform czech,trijodmethane czech,ccris 346,unii-kxi2j76489 PubChem CID: 6374 ChEBI: CHEBI:37758 IUPAC Name: iodoform SMILES: C(I)(I)I
Gli ordini eseguiti prima delle 14:00 saranno spediti oggi stesso. Gli ordini eseguiti dopo le 14:00 saranno spediti domani.
Per saperne di più
| Sinonimo | triiodomethane,methane, triiodo,carbon triiodide,jodoform,trijodmethane,dezinfekt v,jodoform czech,trijodmethane czech,ccris 346,unii-kxi2j76489 |
|---|---|
| Numero MDL | MFCD00001069 |
| PubChem CID | 6374 |
| Formula molecolare | CHI3 |
| CAS | 75-47-8 |
| Molecular Weight (g/mol) | 393.72 |
| ChEBI | CHEBI:37758 |
| SMILES | C(I)(I)I |
| IUPAC Name | iodoform |
| InChI Key | OKJPEAGHQZHRQV-UHFFFAOYSA-N |
Diiododifluoromethane, TRC
CAS: 1184-76-5 Formula molecolare: CF2I2 Molecular Weight (g/mol): 303.82 Sinonimo: Difluorodiiodomethane IUPAC Name: difluoro(diiodo)methane SMILES: FC(F)(I)I
| Sinonimo | Difluorodiiodomethane |
|---|---|
| Formula molecolare | CF2I2 |
| CAS | 1184-76-5 |
| Molecular Weight (g/mol) | 303.82 |
| SMILES | FC(F)(I)I |
| IUPAC Name | difluoro(diiodo)methane |
Dichloromethane, 99.8%, Extra Dry over Molecular Sieve, Stabilized, AcroSeal™
CAS: 75-09-2 Formula molecolare: CH2Cl2 Molecular Weight (g/mol): 84.93 Numero MDL: MFCD00000881 InChI Key: YMWUJEATGCHHMB-UHFFFAOYSA-N Sinonimo: methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm PubChem CID: 6344 ChEBI: CHEBI:15767 IUPAC Name: diclorometano SMILES: ClCCl
| Sinonimo | methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm |
|---|---|
| Numero MDL | MFCD00000881 |
| PubChem CID | 6344 |
| Formula molecolare | CH2Cl2 |
| CAS | 75-09-2 |
| Molecular Weight (g/mol) | 84.93 |
| ChEBI | CHEBI:15767 |
| SMILES | ClCCl |
| IUPAC Name | diclorometano |
| InChI Key | YMWUJEATGCHHMB-UHFFFAOYSA-N |
Iodomethane, 99+%, stab. with copper
CAS: 74-88-4 Formula molecolare: CH3I Molecular Weight (g/mol): 141.94 Numero MDL: MFCD00001073 InChI Key: INQOMBQAUSQDDS-UHFFFAOYSA-N Sinonimo: methyl iodide,monoiodomethane,methane, iodo,methyljodid,jod-methan,methyliodide,methyljodide,iodometano,joodmethaan,metylu jodek PubChem CID: 6328 ChEBI: CHEBI:39282 IUPAC Name: iodomethane SMILES: CI
| Sinonimo | methyl iodide,monoiodomethane,methane, iodo,methyljodid,jod-methan,methyliodide,methyljodide,iodometano,joodmethaan,metylu jodek |
|---|---|
| Numero MDL | MFCD00001073 |
| PubChem CID | 6328 |
| Formula molecolare | CH3I |
| CAS | 74-88-4 |
| Molecular Weight (g/mol) | 141.94 |
| ChEBI | CHEBI:39282 |
| SMILES | CI |
| IUPAC Name | iodomethane |
| InChI Key | INQOMBQAUSQDDS-UHFFFAOYSA-N |
Iodomethane, 99%, stab. with copper
CAS: 74-88-4 Formula molecolare: CH3I Molecular Weight (g/mol): 141.94 Numero MDL: MFCD00001073 InChI Key: INQOMBQAUSQDDS-UHFFFAOYSA-N Sinonimo: methyl iodide,monoiodomethane,methane, iodo,methyljodid,jod-methan,methyliodide,methyljodide,iodometano,joodmethaan,metylu jodek PubChem CID: 6328 ChEBI: CHEBI:39282 IUPAC Name: iodomethane SMILES: CI
| Sinonimo | methyl iodide,monoiodomethane,methane, iodo,methyljodid,jod-methan,methyliodide,methyljodide,iodometano,joodmethaan,metylu jodek |
|---|---|
| Numero MDL | MFCD00001073 |
| PubChem CID | 6328 |
| Formula molecolare | CH3I |
| CAS | 74-88-4 |
| Molecular Weight (g/mol) | 141.94 |
| ChEBI | CHEBI:39282 |
| SMILES | CI |
| IUPAC Name | iodomethane |
| InChI Key | INQOMBQAUSQDDS-UHFFFAOYSA-N |
Heptafluorobutyric acid, 99%
CAS: 375-22-4 Formula molecolare: C4HF7O2 Molecular Weight (g/mol): 214.04 Numero MDL: MFCD00004171 InChI Key: YPJUNDFVDDCYIH-UHFFFAOYSA-N Sinonimo: heptafluorobutyric acid,perfluorobutyric acid,heptafluorobutanoic acid,perfluorobutanoic acid,butanoic acid, heptafluoro,heptafluoro-1-butanoic acid,perfluoropropanecarboxylic acid,butyric acid, heptafluoro,kyselina heptafluormaselna,kyselina heptafluormaselna czech PubChem CID: 9777 ChEBI: CHEBI:39426 IUPAC Name: 2,2,3,3,4,4,4-heptafluorobutanoic acid SMILES: C(=O)(C(C(C(F)(F)F)(F)F)(F)F)O
| Sinonimo | heptafluorobutyric acid,perfluorobutyric acid,heptafluorobutanoic acid,perfluorobutanoic acid,butanoic acid, heptafluoro,heptafluoro-1-butanoic acid,perfluoropropanecarboxylic acid,butyric acid, heptafluoro,kyselina heptafluormaselna,kyselina heptafluormaselna czech |
|---|---|
| Numero MDL | MFCD00004171 |
| PubChem CID | 9777 |
| Formula molecolare | C4HF7O2 |
| CAS | 375-22-4 |
| Molecular Weight (g/mol) | 214.04 |
| ChEBI | CHEBI:39426 |
| SMILES | C(=O)(C(C(C(F)(F)F)(F)F)(F)F)O |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutanoic acid |
| InChI Key | YPJUNDFVDDCYIH-UHFFFAOYSA-N |
Dibromomethane, 99%
CAS: 74-95-3 Formula molecolare: CH2Br2 Molecular Weight (g/mol): 173.835 Numero MDL: MFCD00000168 InChI Key: FJBFPHVGVWTDIP-UHFFFAOYSA-N Sinonimo: methylene bromide,methane, dibromo,methylene dibromide,dibromomethylene,rcra waste number u068,dibrommethan,methylenbromid,dibromo-methane,ccris 939,rcra waste no. u068 PubChem CID: 3024 ChEBI: CHEBI:47077 IUPAC Name: dibromomethane SMILES: C(Br)Br
| Sinonimo | methylene bromide,methane, dibromo,methylene dibromide,dibromomethylene,rcra waste number u068,dibrommethan,methylenbromid,dibromo-methane,ccris 939,rcra waste no. u068 |
|---|---|
| Numero MDL | MFCD00000168 |
| PubChem CID | 3024 |
| Formula molecolare | CH2Br2 |
| CAS | 74-95-3 |
| Molecular Weight (g/mol) | 173.835 |
| ChEBI | CHEBI:47077 |
| SMILES | C(Br)Br |
| IUPAC Name | dibromomethane |
| InChI Key | FJBFPHVGVWTDIP-UHFFFAOYSA-N |
Carbon tetrabromide, 98%
CAS: 558-13-4 Formula molecolare: CBr4 Molecular Weight (g/mol): 331.64 Numero MDL: MFCD00000117 InChI Key: HJUGFYREWKUQJT-UHFFFAOYSA-N Sinonimo: carbon tetrabromide,methane, tetrabromo,carbon bromide,methane tetrabromide,bromid uhlicity,carbontetrabromide,methane, tetrabromide,tetrabrommethan,bromid uhlicity czech PubChem CID: 11205 ChEBI: CHEBI:47875 IUPAC Name: tetrabromomethane SMILES: C(Br)(Br)(Br)Br
| Sinonimo | carbon tetrabromide,methane, tetrabromo,carbon bromide,methane tetrabromide,bromid uhlicity,carbontetrabromide,methane, tetrabromide,tetrabrommethan,bromid uhlicity czech |
|---|---|
| Numero MDL | MFCD00000117 |
| PubChem CID | 11205 |
| Formula molecolare | CBr4 |
| CAS | 558-13-4 |
| Molecular Weight (g/mol) | 331.64 |
| ChEBI | CHEBI:47875 |
| SMILES | C(Br)(Br)(Br)Br |
| IUPAC Name | tetrabromomethane |
| InChI Key | HJUGFYREWKUQJT-UHFFFAOYSA-N |