Bismuth (Bi)
Bismuth was discovered in 1753 and is sometimes confused with tin and lead.
It's a white, crystalline, and brittle metal with a pinkish tinge. The element occurs naturally in the ores bismuthinite (bismuth glance) and bismite. And when it's heated in air, it produces a blue flame and forms yellow fumes.
In water, its soluble salts form insoluble basic salts. Some compounds are used in cosmetics and in medicine.
When combined with manganese, it forms 'Bismanol', a strong permanent magnet. Its alloys are used to make objects subject to damage by high temperatures, including fire detection devices and extinguishing systems.
- (1)
- (2)
- (1)
- (15)
- (7)
- (4)
- (2)
- (2)
- (1)
- (1)
- (1)
- (2)
- (12)
- (4)
- (3)
- (7)
- (6)
- (2)
- (3)
- (4)
- (10)
- (7)
- (3)
- (39)
- (2)
- (2)
- (7)
- (4)
- (3)
- (3)
- (1)
- (5)
- (3)
Risultati della ricerca filtrata
Bismuth granules, 1-2mm (0.04-0.08in), 99.997% (metals basis), Thermo Scientific Chemicals
CAS: 7440-69-9 Formula molecolare: Bi Molecular Weight (g/mol): 208.98 Numero MDL: MFCD00134033 InChI Key: JCXGWMGPZLAOME-UHFFFAOYSA-N Sinonimo: bismuth, elemental,unii-u015tt5i8h,powder,iii ion,shot, elongated,rod, 12.7mm 0.5in dia,atom,needles,pieces,rod PubChem CID: 5359367 ChEBI: CHEBI:33301 IUPAC Name: bismuth SMILES: [Bi]
| Sinonimo | bismuth, elemental,unii-u015tt5i8h,powder,iii ion,shot, elongated,rod, 12.7mm 0.5in dia,atom,needles,pieces,rod |
|---|---|
| Numero MDL | MFCD00134033 |
| PubChem CID | 5359367 |
| Formula molecolare | Bi |
| CAS | 7440-69-9 |
| Molecular Weight (g/mol) | 208.98 |
| ChEBI | CHEBI:33301 |
| SMILES | [Bi] |
| IUPAC Name | bismuth |
| InChI Key | JCXGWMGPZLAOME-UHFFFAOYSA-N |
Bismuth powder, -100 mesh, 99.5% (metals basis), Thermo Scientific Chemicals
CAS: 7440-69-9 Formula molecolare: Bi Molecular Weight (g/mol): 208.98 Numero MDL: MFCD00134033 InChI Key: JCXGWMGPZLAOME-UHFFFAOYSA-N Sinonimo: bismuth, elemental,unii-u015tt5i8h,powder,iii ion,shot, elongated,rod, 12.7mm 0.5in dia,atom,needles,pieces,rod PubChem CID: 5359367 ChEBI: CHEBI:33301 IUPAC Name: bismuth SMILES: [Bi]
| Sinonimo | bismuth, elemental,unii-u015tt5i8h,powder,iii ion,shot, elongated,rod, 12.7mm 0.5in dia,atom,needles,pieces,rod |
|---|---|
| Numero MDL | MFCD00134033 |
| PubChem CID | 5359367 |
| Formula molecolare | Bi |
| CAS | 7440-69-9 |
| Molecular Weight (g/mol) | 208.98 |
| ChEBI | CHEBI:33301 |
| SMILES | [Bi] |
| IUPAC Name | bismuth |
| InChI Key | JCXGWMGPZLAOME-UHFFFAOYSA-N |
Bismuth pieces, 10cm (3.9in) & down, 99.99% (metals basis), Thermo Scientific Chemicals
CAS: 7440-69-9 Formula molecolare: Bi Molecular Weight (g/mol): 208.98 Numero MDL: MFCD00134033 InChI Key: JCXGWMGPZLAOME-UHFFFAOYSA-N Sinonimo: bismuth, elemental,unii-u015tt5i8h,powder,iii ion,shot, elongated,rod, 12.7mm 0.5in dia,atom,needles,pieces,rod PubChem CID: 5359367 ChEBI: CHEBI:33301 IUPAC Name: bismuth SMILES: [Bi]
| Sinonimo | bismuth, elemental,unii-u015tt5i8h,powder,iii ion,shot, elongated,rod, 12.7mm 0.5in dia,atom,needles,pieces,rod |
|---|---|
| Numero MDL | MFCD00134033 |
| PubChem CID | 5359367 |
| Formula molecolare | Bi |
| CAS | 7440-69-9 |
| Molecular Weight (g/mol) | 208.98 |
| ChEBI | CHEBI:33301 |
| SMILES | [Bi] |
| IUPAC Name | bismuth |
| InChI Key | JCXGWMGPZLAOME-UHFFFAOYSA-N |
Bismuth powder, -200 mesh, 99.999% (metals basis), Thermo Scientific Chemicals
CAS: 7440-69-9 Formula molecolare: Bi Molecular Weight (g/mol): 208.98 Numero MDL: MFCD00134033 InChI Key: JCXGWMGPZLAOME-UHFFFAOYSA-N Sinonimo: bismuth, elemental,unii-u015tt5i8h,powder,iii ion,shot, elongated,rod, 12.7mm 0.5in dia,atom,needles,pieces,rod PubChem CID: 5359367 ChEBI: CHEBI:33301 IUPAC Name: bismuth SMILES: [Bi]
| Sinonimo | bismuth, elemental,unii-u015tt5i8h,powder,iii ion,shot, elongated,rod, 12.7mm 0.5in dia,atom,needles,pieces,rod |
|---|---|
| Numero MDL | MFCD00134033 |
| PubChem CID | 5359367 |
| Formula molecolare | Bi |
| CAS | 7440-69-9 |
| Molecular Weight (g/mol) | 208.98 |
| ChEBI | CHEBI:33301 |
| SMILES | [Bi] |
| IUPAC Name | bismuth |
| InChI Key | JCXGWMGPZLAOME-UHFFFAOYSA-N |
Bismuth foil, 2.0mm (0.08 in.) thick, 99.999% (metals basis), Thermo Scientific Chemicals
CAS: 7440-69-9 Formula molecolare: Bi Molecular Weight (g/mol): 208.98 Numero MDL: MFCD00134033 InChI Key: JCXGWMGPZLAOME-UHFFFAOYSA-N Sinonimo: bismuth, elemental,unii-u015tt5i8h,powder,iii ion,shot, elongated,rod, 12.7mm 0.5in dia,atom,needles,pieces,rod PubChem CID: 5359367 ChEBI: CHEBI:33301 IUPAC Name: bismuth SMILES: [Bi]
| Sinonimo | bismuth, elemental,unii-u015tt5i8h,powder,iii ion,shot, elongated,rod, 12.7mm 0.5in dia,atom,needles,pieces,rod |
|---|---|
| Numero MDL | MFCD00134033 |
| PubChem CID | 5359367 |
| Formula molecolare | Bi |
| CAS | 7440-69-9 |
| Molecular Weight (g/mol) | 208.98 |
| ChEBI | CHEBI:33301 |
| SMILES | [Bi] |
| IUPAC Name | bismuth |
| InChI Key | JCXGWMGPZLAOME-UHFFFAOYSA-N |
Bismuth rod, 12.7mm (0.5in) dia, 99.999+% (metals basis), Thermo Scientific Chemicals
CAS: 7440-69-9 Formula molecolare: Bi Molecular Weight (g/mol): 208.98 Numero MDL: MFCD00134033 InChI Key: JCXGWMGPZLAOME-UHFFFAOYSA-N Sinonimo: bismuth, elemental,unii-u015tt5i8h,powder,iii ion,shot, elongated,rod, 12.7mm 0.5in dia,atom,needles,pieces,rod PubChem CID: 5359367 ChEBI: CHEBI:33301 IUPAC Name: bismuth SMILES: [Bi]
| Sinonimo | bismuth, elemental,unii-u015tt5i8h,powder,iii ion,shot, elongated,rod, 12.7mm 0.5in dia,atom,needles,pieces,rod |
|---|---|
| Numero MDL | MFCD00134033 |
| PubChem CID | 5359367 |
| Formula molecolare | Bi |
| CAS | 7440-69-9 |
| Molecular Weight (g/mol) | 208.98 |
| ChEBI | CHEBI:33301 |
| SMILES | [Bi] |
| IUPAC Name | bismuth |
| InChI Key | JCXGWMGPZLAOME-UHFFFAOYSA-N |
Bismuth needles, 1-5cm (0.4-2in) long, 99.998% (metals basis), Thermo Scientific Chemicals
CAS: 7440-69-9 Formula molecolare: Bi Molecular Weight (g/mol): 208.98 Numero MDL: MFCD00134033 InChI Key: JCXGWMGPZLAOME-UHFFFAOYSA-N Sinonimo: bismuth, elemental,unii-u015tt5i8h,powder,iii ion,shot, elongated,rod, 12.7mm 0.5in dia,atom,needles,pieces,rod PubChem CID: 5359367 ChEBI: CHEBI:33301 IUPAC Name: bismuth SMILES: [Bi]
| Sinonimo | bismuth, elemental,unii-u015tt5i8h,powder,iii ion,shot, elongated,rod, 12.7mm 0.5in dia,atom,needles,pieces,rod |
|---|---|
| Numero MDL | MFCD00134033 |
| PubChem CID | 5359367 |
| Formula molecolare | Bi |
| CAS | 7440-69-9 |
| Molecular Weight (g/mol) | 208.98 |
| ChEBI | CHEBI:33301 |
| SMILES | [Bi] |
| IUPAC Name | bismuth |
| InChI Key | JCXGWMGPZLAOME-UHFFFAOYSA-N |
Bismuth, 99%, powder, -100 mesh, Thermo Scientific Chemicals
CAS: 7440-69-9 Formula molecolare: Bi Molecular Weight (g/mol): 208.98 Numero MDL: MFCD00134033 InChI Key: JCXGWMGPZLAOME-UHFFFAOYSA-N Sinonimo: pieces,bismuth, elemental,rod, 12.7mm 0.5in dia,atom,rod,powder,unii-u015tt5i8h,iii ion,shot, elongated,needles PubChem CID: 5359367 ChEBI: CHEBI:33301 IUPAC Name: bismuth SMILES: [Bi]
| Sinonimo | pieces,bismuth, elemental,rod, 12.7mm 0.5in dia,atom,rod,powder,unii-u015tt5i8h,iii ion,shot, elongated,needles |
|---|---|
| Numero MDL | MFCD00134033 |
| PubChem CID | 5359367 |
| Formula molecolare | Bi |
| CAS | 7440-69-9 |
| Molecular Weight (g/mol) | 208.98 |
| ChEBI | CHEBI:33301 |
| SMILES | [Bi] |
| IUPAC Name | bismuth |
| InChI Key | JCXGWMGPZLAOME-UHFFFAOYSA-N |
Bismuth powder, -325 mesh, 99.5% (metals basis), Thermo Scientific Chemicals
CAS: 7440-69-9 Formula molecolare: Bi Molecular Weight (g/mol): 208.98 Numero MDL: MFCD00134033 InChI Key: JCXGWMGPZLAOME-UHFFFAOYSA-N Sinonimo: bismuth, elemental,unii-u015tt5i8h,powder,iii ion,shot, elongated,rod, 12.7mm 0.5in dia,atom,needles,pieces,rod PubChem CID: 5359367 ChEBI: CHEBI:33301 IUPAC Name: bismuth SMILES: [Bi]
| Sinonimo | bismuth, elemental,unii-u015tt5i8h,powder,iii ion,shot, elongated,rod, 12.7mm 0.5in dia,atom,needles,pieces,rod |
|---|---|
| Numero MDL | MFCD00134033 |
| PubChem CID | 5359367 |
| Formula molecolare | Bi |
| CAS | 7440-69-9 |
| Molecular Weight (g/mol) | 208.98 |
| ChEBI | CHEBI:33301 |
| SMILES | [Bi] |
| IUPAC Name | bismuth |
| InChI Key | JCXGWMGPZLAOME-UHFFFAOYSA-N |
| Forma | Ingot |
|---|---|
| Informazioni di solubilità | Insoluble in water. |
| Media Mol. Peso o mole Intervallo di peso | Bi:In:Sn; 32.5:51:16.5 wt% |
| Conservazione consigliata | Ambient temperatures |
| TSCA | Yes |
| Materiale o nome chimico | Bismuth Indium Tin ingot (Field's metal) |
| Numero MDL | MFCD00143771 |
|---|---|
| Note percentuale saggio | (metals basis) |
| Forma | Lump |
| Percent Purity | 99.95% |
| Media Mol. Peso o mole Intervallo di peso | Bi:Sn; 58:42 wt% |
| Punto di fusione | 138°C |
| Conservazione consigliata | Ambient temperatures |
| TSCA | Yes |
| Materiale o nome chimico | Bismuth Tin eutectic lump |
Bismuth Lead Tin ingot (Rose's metal)
CAS: 56001-37-7 Formula molecolare: C10H14N5Na2O14P3 Molecular Weight (g/mol): 567.14 Numero MDL: MFCD03410297 InChI Key: FIZIYLKEXVIRHJ-KHRSEZDTNA-L Sinonimo: guanosine 5'-triphosphate,guanosine-5'-triphosphate disodium salt dihydrate gtp,guanosine-triphosphate,guanosine 5'-triphosphate 4-,gtp 4-,2r,3s,4r,5r-5-2-amino-6-hydroxy-9h-purin-9-yl-3,4-dihydroxyoxolan-2-yl methyl phosphonato oxy phosphonatooxy phosphinate,2r,3s,4r,5r-5-2-amino-6-oxo-3h-purin-9-yl-3,4-dihydroxyoxolan-2-yl methoxy-oxidophosphoryl oxy-oxidophosphoryl phosphate PubChem CID: 131676145 IUPAC Name: ({[(2R,3S,4R,5R)-5-(2-amino-6-oxo-6,9-dihydro-3H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphonato}oxy)(phosphonatooxy)phosphinate SMILES: [Na+].[Na+].NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP([O-])(=O)OP([O-])(=O)OP(O)(O)=O)[C@@H](O)[C@H]2O)C(=O)N1
| Sinonimo | guanosine 5'-triphosphate,guanosine-5'-triphosphate disodium salt dihydrate gtp,guanosine-triphosphate,guanosine 5'-triphosphate 4-,gtp 4-,2r,3s,4r,5r-5-2-amino-6-hydroxy-9h-purin-9-yl-3,4-dihydroxyoxolan-2-yl methyl phosphonato oxy phosphonatooxy phosphinate,2r,3s,4r,5r-5-2-amino-6-oxo-3h-purin-9-yl-3,4-dihydroxyoxolan-2-yl methoxy-oxidophosphoryl oxy-oxidophosphoryl phosphate |
|---|---|
| Numero MDL | MFCD03410297 |
| PubChem CID | 131676145 |
| Formula molecolare | C10H14N5Na2O14P3 |
| CAS | 56001-37-7 |
| Molecular Weight (g/mol) | 567.14 |
| SMILES | [Na+].[Na+].NC1=NC2=C(N=CN2[C@@H]2O[C@H](COP([O-])(=O)OP([O-])(=O)OP(O)(O)=O)[C@@H](O)[C@H]2O)C(=O)N1 |
| IUPAC Name | ({[(2R,3S,4R,5R)-5-(2-amino-6-oxo-6,9-dihydro-3H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphonato}oxy)(phosphonatooxy)phosphinate |
| InChI Key | FIZIYLKEXVIRHJ-KHRSEZDTNA-L |
Bismuth needles, 99.99% (metals basis), Thermo Scientific Chemicals
CAS: 7440-69-9 Formula molecolare: Bi Molecular Weight (g/mol): 208.98 Numero MDL: MFCD00134033 InChI Key: JCXGWMGPZLAOME-UHFFFAOYSA-N Sinonimo: bismuth, elemental,unii-u015tt5i8h,powder,iii ion,shot, elongated,rod, 12.7mm 0.5in dia,atom,needles,pieces,rod PubChem CID: 5359367 ChEBI: CHEBI:33301 IUPAC Name: bismuth SMILES: [Bi]
| Sinonimo | bismuth, elemental,unii-u015tt5i8h,powder,iii ion,shot, elongated,rod, 12.7mm 0.5in dia,atom,needles,pieces,rod |
|---|---|
| Numero MDL | MFCD00134033 |
| PubChem CID | 5359367 |
| Formula molecolare | Bi |
| CAS | 7440-69-9 |
| Molecular Weight (g/mol) | 208.98 |
| ChEBI | CHEBI:33301 |
| SMILES | [Bi] |
| IUPAC Name | bismuth |
| InChI Key | JCXGWMGPZLAOME-UHFFFAOYSA-N |
- Precedente
- 1
- 2
- Successivo