Risultati della ricerca filtrata
n-Butyllithium, 2.5M solution in hexanes, AcroSeal™
CAS: 109-72-8 Formula molecolare: C4H9Li Molecular Weight (g/mol): 64.06 Numero MDL: MFCD00009414 InChI Key: MZRVEZGGRBJDDB-UHFFFAOYSA-N Sinonimo: n-butyllithium,lithium, butyl,butyllithium,butyl lithium,n-butyl lithium,lithium butane,n-buli,buli,libu,unii-09w9a6b8zc PubChem CID: 61028 SMILES: [Li]CCCC
| Sinonimo | n-butyllithium,lithium, butyl,butyllithium,butyl lithium,n-butyl lithium,lithium butane,n-buli,buli,libu,unii-09w9a6b8zc |
|---|---|
| Numero MDL | MFCD00009414 |
| PubChem CID | 61028 |
| Formula molecolare | C4H9Li |
| CAS | 109-72-8 |
| Molecular Weight (g/mol) | 64.06 |
| SMILES | [Li]CCCC |
| InChI Key | MZRVEZGGRBJDDB-UHFFFAOYSA-N |
Zinc sulfate heptahydrate, ACS, 99.0-103.0%
CAS: 7446-20-0 Formula molecolare: H14O11SZn Molecular Weight (g/mol): 287.54 Numero MDL: MFCD00149894 InChI Key: RZLVQBNCHSJZPX-UHFFFAOYSA-L Sinonimo: zinc sulfate heptahydrate,zinc sulfate jan,zinc sulfate 1:1 heptahydrate,unii-n57ji2k7wp,zinc vitriol heptahydrate,zinc sulfate heptahydrate 1:1:7,white vitriol heptahydrate,ccris 5563,zinc sulfate znso4 heptahydrate,znso4.7h2o PubChem CID: 62640 ChEBI: CHEBI:32312 IUPAC Name: zinc;sulfate;heptahydrate SMILES: O.O.O.O.O.O.O.[Zn++].[O-]S([O-])(=O)=O
| Sinonimo | zinc sulfate heptahydrate,zinc sulfate jan,zinc sulfate 1:1 heptahydrate,unii-n57ji2k7wp,zinc vitriol heptahydrate,zinc sulfate heptahydrate 1:1:7,white vitriol heptahydrate,ccris 5563,zinc sulfate znso4 heptahydrate,znso4.7h2o |
|---|---|
| Numero MDL | MFCD00149894 |
| PubChem CID | 62640 |
| Formula molecolare | H14O11SZn |
| CAS | 7446-20-0 |
| Molecular Weight (g/mol) | 287.54 |
| ChEBI | CHEBI:32312 |
| SMILES | O.O.O.O.O.O.O.[Zn++].[O-]S([O-])(=O)=O |
| IUPAC Name | zinc;sulfate;heptahydrate |
| InChI Key | RZLVQBNCHSJZPX-UHFFFAOYSA-L |
Tetrabutylammonium hydroxide, 40 wt.% (1.5M) solution in water
CAS: 2052-49-5 | C16H37NO | 259.48 g/mol
| Peso formulazione | 259.46 |
|---|---|
| Formula lineare | [CH3(CH2)3]4NOH |
| Pericolo per la salute 1 | GHS Signal Word: Danger |
| Pericolo per la salute 2 | GHS H Statement Causes severe skin burns and eye damage. Harmful if swallowed. |
| Pericolo per la salute 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: Rinse mouth. Do NOT induce vomiting. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with wat |
| Forma fisica | Crystals or Powder |
| Molecular Weight (g/mol) | 259.48 |
| InChI Key | VDZOOKBUILJEDG-UHFFFAOYSA-M |
| Punti di ebollizione | >100.0°C |
| Gravità specifica | 0.995 |
| PubChem CID | 2723671 |
| Percent Purity | 38 to 42% (Total base) |
| Fieser | 05,645; 11,500 |
| Materiale o nome chimico | Tetrabutylammonium hydroxide |
| Sinonimo | tetrabutylammonium hydroxide,tetra-n-butylammonium hydroxide,tetrabutylazanium hydroxide,tetrabutylammoniumhydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide,ammonium, tetrabutyl-, hydroxide,n,n,n-tributyl-1-butanaminium hydroxide,tetra n-butyl ammonium hydroxide,tetra-n-butyl ammonium hydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide 1:1 |
| Numero MDL | MFCD00009425 |
| Nota nome | 40 wt.% Solution in Water |
| Colore | White to Yellow |
| SMILES | [OH-].CCCC[N+](CCCC)(CCCC)CCCC |
| Densità | 0.9950g/mL |
| Imballaggio | Plastic bottle |
| Formula molecolare | C16H37NO |
| Informazioni di solubilità | Solubility in water: soluble. |
| CAS | 7732-18-5 |
| IUPAC Name | tetrabutylazanium;hydroxide |
| Beilstein | 04, II, 634 |
| EINECS Number | 218-147-6 |
Lithium bromide, 99%, pure, anhydrous
CAS: 7550-35-8 Formula molecolare: BrLi Molecular Weight (g/mol): 86.84 InChI Key: AMXOYNBUYSYVKV-UHFFFAOYSA-M Sinonimo: lithium bromide,lithium monobromide,lithium bromide libr,lithiumbromide,libr,lithium 1+ ion bromide,lithium bromide, anhydrous,lithium bromide, ultra dry,bromolithium,lithium-bromide PubChem CID: 82050 ChEBI: CHEBI:63042 IUPAC Name: lithium;bromide SMILES: [Li+].[Br-]
| Sinonimo | lithium bromide,lithium monobromide,lithium bromide libr,lithiumbromide,libr,lithium 1+ ion bromide,lithium bromide, anhydrous,lithium bromide, ultra dry,bromolithium,lithium-bromide |
|---|---|
| PubChem CID | 82050 |
| Formula molecolare | BrLi |
| CAS | 7550-35-8 |
| Molecular Weight (g/mol) | 86.84 |
| ChEBI | CHEBI:63042 |
| SMILES | [Li+].[Br-] |
| IUPAC Name | lithium;bromide |
| InChI Key | AMXOYNBUYSYVKV-UHFFFAOYSA-M |
Lithium bromide, anhydrous, 99% min
CAS: 7550-35-8 Formula molecolare: BrLi Molecular Weight (g/mol): 86.844 Numero MDL: MFCD00011077 InChI Key: AMXOYNBUYSYVKV-UHFFFAOYSA-M Sinonimo: lithium bromide,lithium monobromide,lithium bromide libr,lithiumbromide,libr,lithium 1+ ion bromide,lithium bromide, anhydrous,lithium bromide, ultra dry,bromolithium,lithium-bromide PubChem CID: 82050 ChEBI: CHEBI:63042 IUPAC Name: lithium;bromide SMILES: [Li+].[Br-]
| Sinonimo | lithium bromide,lithium monobromide,lithium bromide libr,lithiumbromide,libr,lithium 1+ ion bromide,lithium bromide, anhydrous,lithium bromide, ultra dry,bromolithium,lithium-bromide |
|---|---|
| Numero MDL | MFCD00011077 |
| PubChem CID | 82050 |
| Formula molecolare | BrLi |
| CAS | 7550-35-8 |
| Molecular Weight (g/mol) | 86.844 |
| ChEBI | CHEBI:63042 |
| SMILES | [Li+].[Br-] |
| IUPAC Name | lithium;bromide |
| InChI Key | AMXOYNBUYSYVKV-UHFFFAOYSA-M |
Adiponitrile, 99+%, packaged under Argon in resealable ChemSeal™ bottles
CAS: 111-69-3 Formula molecolare: C6H8N2 Molecular Weight (g/mol): 108.144 Numero MDL: MFCD00001975 InChI Key: BTGRAWJCKBQKAO-UHFFFAOYSA-N Sinonimo: adiponitrile,1,4-dicyanobutane,adipodinitrile,adipyldinitrile,adipic acid dinitrile,tetramethylene dicyanide,nitrile adipico,tetramethylene cyanide,adipic acid nitrile,adipinsaeuredinitril PubChem CID: 8128 IUPAC Name: hexanedinitrile SMILES: C(CCC#N)CC#N
| Sinonimo | adiponitrile,1,4-dicyanobutane,adipodinitrile,adipyldinitrile,adipic acid dinitrile,tetramethylene dicyanide,nitrile adipico,tetramethylene cyanide,adipic acid nitrile,adipinsaeuredinitril |
|---|---|
| Numero MDL | MFCD00001975 |
| PubChem CID | 8128 |
| Formula molecolare | C6H8N2 |
| CAS | 111-69-3 |
| Molecular Weight (g/mol) | 108.144 |
| SMILES | C(CCC#N)CC#N |
| IUPAC Name | hexanedinitrile |
| InChI Key | BTGRAWJCKBQKAO-UHFFFAOYSA-N |
Lithium hydroxide, anhydrous, 98%
CAS: 1310-65-2 Formula molecolare: HLiO Molecular Weight (g/mol): 23.95 Numero MDL: MFCD00011095 InChI Key: WMFOQBRAJBCJND-UHFFFAOYSA-M Sinonimo: lithium hydroxide,lithium hydrate,lioh,lithium hydroxide anhydrous,lithium hydroxide li oh,lithiumhydroxid,lithiumhydroxide,lithium hydoxide,unii-903yl31jas,lithium hydroxide, anhydrous PubChem CID: 3939 ChEBI: CHEBI:33979 SMILES: [Li+].[OH-]
| Sinonimo | lithium hydroxide,lithium hydrate,lioh,lithium hydroxide anhydrous,lithium hydroxide li oh,lithiumhydroxid,lithiumhydroxide,lithium hydoxide,unii-903yl31jas,lithium hydroxide, anhydrous |
|---|---|
| Numero MDL | MFCD00011095 |
| PubChem CID | 3939 |
| Formula molecolare | HLiO |
| CAS | 1310-65-2 |
| Molecular Weight (g/mol) | 23.95 |
| ChEBI | CHEBI:33979 |
| SMILES | [Li+].[OH-] |
| InChI Key | WMFOQBRAJBCJND-UHFFFAOYSA-M |
Tritolyl phosphate, mixture of isomers
CAS: 1330-78-5 Formula molecolare: C21H21O4P Numero MDL: MFCD02102116 Sinonimo: Tricresyl phosphate; TCP
| Sinonimo | Tricresyl phosphate; TCP |
|---|---|
| Numero MDL | MFCD02102116 |
| Formula molecolare | C21H21O4P |
| CAS | 1330-78-5 |
Lithium nitrate, anhydrous, 99%
CAS: 7790-69-4 Formula molecolare: LiNO3 Molecular Weight (g/mol): 68.94 Numero MDL: MFCD00011094 InChI Key: IIPYXGDZVMZOAP-UHFFFAOYSA-N Sinonimo: lithium nitrate,nitric acid, lithium salt,lithium nitrate, anhydrous,lithium 1+ ion nitronate,ksc492i7j,lithium nitrate 3-hydrate,lithium 1+ ion nitrate,lithium nitrate, anhydrous 25g,lithium nitrate, ionization buffer solution, specpure PubChem CID: 10129889 ChEBI: CHEBI:63315 SMILES: [Li+].[O-][N+]([O-])=O
| Sinonimo | lithium nitrate,nitric acid, lithium salt,lithium nitrate, anhydrous,lithium 1+ ion nitronate,ksc492i7j,lithium nitrate 3-hydrate,lithium 1+ ion nitrate,lithium nitrate, anhydrous 25g,lithium nitrate, ionization buffer solution, specpure |
|---|---|
| Numero MDL | MFCD00011094 |
| PubChem CID | 10129889 |
| Formula molecolare | LiNO3 |
| CAS | 7790-69-4 |
| Molecular Weight (g/mol) | 68.94 |
| ChEBI | CHEBI:63315 |
| SMILES | [Li+].[O-][N+]([O-])=O |
| InChI Key | IIPYXGDZVMZOAP-UHFFFAOYSA-N |
Potassium hydroxide, flake, 85%
CAS: 1310-58-3 Formula molecolare: HKO Molecular Weight (g/mol): 56.11 Numero MDL: MFCD00003553 InChI Key: KWYUFKZDYYNOTN-UHFFFAOYSA-M IUPAC Name: potassium hydroxide SMILES: [OH-].[K+]
| Numero MDL | MFCD00003553 |
|---|---|
| Formula molecolare | HKO |
| CAS | 1310-58-3 |
| Molecular Weight (g/mol) | 56.11 |
| SMILES | [OH-].[K+] |
| IUPAC Name | potassium hydroxide |
| InChI Key | KWYUFKZDYYNOTN-UHFFFAOYSA-M |
Sodium bromide, 99+% (dry wt.), water <1.0%
CAS: 7647-15-6 Formula molecolare: BrNa Molecular Weight (g/mol): 102.89 Numero MDL: MFCD00003475 InChI Key: JHJLBTNAGRQEKS-UHFFFAOYSA-M Sinonimo: sodium bromide,bromide salt of sodium,sodium bromide nabr,sedoneural,sodiumbromide,trisodium tribromide,bromnatrium,nabr,bromnatrium german,caswell no. 750a PubChem CID: 253881 ChEBI: CHEBI:63004 SMILES: [Na+].[Br-]
| Sinonimo | sodium bromide,bromide salt of sodium,sodium bromide nabr,sedoneural,sodiumbromide,trisodium tribromide,bromnatrium,nabr,bromnatrium german,caswell no. 750a |
|---|---|
| Numero MDL | MFCD00003475 |
| PubChem CID | 253881 |
| Formula molecolare | BrNa |
| CAS | 7647-15-6 |
| Molecular Weight (g/mol) | 102.89 |
| ChEBI | CHEBI:63004 |
| SMILES | [Na+].[Br-] |
| InChI Key | JHJLBTNAGRQEKS-UHFFFAOYSA-M |
Lithium tetrafluoroborate, 98%
CAS: 14283-07-9 Formula molecolare: BF4Li Molecular Weight (g/mol): 93.74 Numero MDL: MFCD00011087 InChI Key: UFXJWFBILHTTET-UHFFFAOYSA-N Sinonimo: lithium tetrafluoroborate,lithium fluoroborate,lithium tetra fluoroborate,lithium 1+ ion tetrafluoroborate,lithium borofluoride,unii-af751cnk2n,libf4,lithotab tetrafluoroborate,acmc-209cp3,af751cnk2n PubChem CID: 4298216 IUPAC Name: lithium;tetrafluoroborate SMILES: [Li+].F[B-](F)(F)F
| Sinonimo | lithium tetrafluoroborate,lithium fluoroborate,lithium tetra fluoroborate,lithium 1+ ion tetrafluoroborate,lithium borofluoride,unii-af751cnk2n,libf4,lithotab tetrafluoroborate,acmc-209cp3,af751cnk2n |
|---|---|
| Numero MDL | MFCD00011087 |
| PubChem CID | 4298216 |
| Formula molecolare | BF4Li |
| CAS | 14283-07-9 |
| Molecular Weight (g/mol) | 93.74 |
| SMILES | [Li+].F[B-](F)(F)F |
| IUPAC Name | lithium;tetrafluoroborate |
| InChI Key | UFXJWFBILHTTET-UHFFFAOYSA-N |
Tetraheptylammonium bromide, 99%
CAS: 4368-51-8 Formula molecolare: C28H60BrN Molecular Weight (g/mol): 490.69 Numero MDL: MFCD00011861 InChI Key: YQIVQBMEBZGFBY-UHFFFAOYSA-M Sinonimo: tetraheptylammonium bromide,tetra-n-heptylammonium bromide,1-heptanaminium, n,n,n-triheptyl-, bromide,tetraheptylazanium bromide,1-heptanaminium, n,n,n-triheptyl-, bromide 1:1,acmc-209jv6,nhep4 1+ *br 1- PubChem CID: 78073 IUPAC Name: tetraheptylazanium;bromide SMILES: CCCCCCC[N+](CCCCCCC)(CCCCCCC)CCCCCCC.[Br-]
| Sinonimo | tetraheptylammonium bromide,tetra-n-heptylammonium bromide,1-heptanaminium, n,n,n-triheptyl-, bromide,tetraheptylazanium bromide,1-heptanaminium, n,n,n-triheptyl-, bromide 1:1,acmc-209jv6,nhep4 1+ *br 1- |
|---|---|
| Numero MDL | MFCD00011861 |
| PubChem CID | 78073 |
| Formula molecolare | C28H60BrN |
| CAS | 4368-51-8 |
| Molecular Weight (g/mol) | 490.69 |
| SMILES | CCCCCCC[N+](CCCCCCC)(CCCCCCC)CCCCCCC.[Br-] |
| IUPAC Name | tetraheptylazanium;bromide |
| InChI Key | YQIVQBMEBZGFBY-UHFFFAOYSA-M |
Lithium trifluoromethanesulfonate, 98%
CAS: 33454-82-9 Formula molecolare: CF3LiO3S Molecular Weight (g/mol): 156.01 Numero MDL: MFCD00013227 InChI Key: MCVFFRWZNYZUIJ-UHFFFAOYSA-M Sinonimo: lithium trifluoromethanesulfonate,lithium triflate,li triflate,lithium trifluoromethanesulphonate,methanesulfonic acid, trifluoro-, lithium salt,unii-1c966kv50i,trifluoromethanesulfonic acid lithium salt,lithium 1+ ion trifluoromethanesulfonate,methanesulfonic acid, 1,1,1-trifluoro-, lithium salt 1:1,trifluoromethanesulfonic acid, lithium salt PubChem CID: 3664839 IUPAC Name: lithium;trifluoromethanesulfonate SMILES: [Li+].C(F)(F)(F)S(=O)(=O)[O-]
| Sinonimo | lithium trifluoromethanesulfonate,lithium triflate,li triflate,lithium trifluoromethanesulphonate,methanesulfonic acid, trifluoro-, lithium salt,unii-1c966kv50i,trifluoromethanesulfonic acid lithium salt,lithium 1+ ion trifluoromethanesulfonate,methanesulfonic acid, 1,1,1-trifluoro-, lithium salt 1:1,trifluoromethanesulfonic acid, lithium salt |
|---|---|
| Numero MDL | MFCD00013227 |
| PubChem CID | 3664839 |
| Formula molecolare | CF3LiO3S |
| CAS | 33454-82-9 |
| Molecular Weight (g/mol) | 156.01 |
| SMILES | [Li+].C(F)(F)(F)S(=O)(=O)[O-] |
| IUPAC Name | lithium;trifluoromethanesulfonate |
| InChI Key | MCVFFRWZNYZUIJ-UHFFFAOYSA-M |
Lithium hexafluorophosphate, 98%
CAS: 21324-40-3 Formula molecolare: F6LiP Molecular Weight (g/mol): 151.904 Numero MDL: MFCD00011096 InChI Key: AXPLOJNSKRXQPA-UHFFFAOYSA-N Sinonimo: lithium hexafluorophosphate,lithium hexafluorophosphate v,phosphate 1-, hexafluoro-, lithium,phosphate 1-, hexafluoro-, lithium 1:1,lithiumhexafluorophosphate,lithium hexafluorophosphate 1-,lipf6,lithium hexafluoroposphate,acmc-209fj7,ksc492g4h PubChem CID: 23688915 IUPAC Name: lithium;hexafluorophosphate SMILES: [Li+].F[P-](F)(F)(F)(F)F
| Sinonimo | lithium hexafluorophosphate,lithium hexafluorophosphate v,phosphate 1-, hexafluoro-, lithium,phosphate 1-, hexafluoro-, lithium 1:1,lithiumhexafluorophosphate,lithium hexafluorophosphate 1-,lipf6,lithium hexafluoroposphate,acmc-209fj7,ksc492g4h |
|---|---|
| Numero MDL | MFCD00011096 |
| PubChem CID | 23688915 |
| Formula molecolare | F6LiP |
| CAS | 21324-40-3 |
| Molecular Weight (g/mol) | 151.904 |
| SMILES | [Li+].F[P-](F)(F)(F)(F)F |
| IUPAC Name | lithium;hexafluorophosphate |
| InChI Key | AXPLOJNSKRXQPA-UHFFFAOYSA-N |
- Precedente
- 1
- 2
- Successivo