Organometallic Compounds
Risultati della ricerca filtrata
Lithium bis(trimethylsilyl)amide, 1M solution in THF, AcroSeal™
CAS: 4039-32-1 | C6H18LiNSi2 | 167.33 g/mol
| Peso formulazione | 167.33 |
|---|---|
| Sinonimo | lithium bis trimethylsilyl amide,lithium hexamethyldisilazide,lihmds,lhmds,hexamethyldisilazane lithium salt,unii-rc4n1i108m,lithiumbis trimethylsilyl amide,lithium bis trimethylsilyl azanide,lithium hexamethyldisilazane,lithium bis-trimethylsilyl amide |
| Formula lineare | ((CH3)3Si)2NLi |
| Pericolo per la salute 1 | GHS Signal Word: Danger |
| Pericolo per la salute 2 | GHS H Statement Highly flammable liquid and vapor. Causes severe skin burns and eye damage. May cause respiratory irritation. Suspected of causing cancer. May form explosive peroxides. Reacts violently with water.<br/ |
| Pericolo per la salute 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. Wear protective gloves/protective clothing/eye p |
| Molecular Weight (g/mol) | 167.33 |
| SMILES | [Li+].C[Si](C)(C)[N-][Si](C)(C)C |
| Densità | 0.9000g/mL |
| InChI Key | YNESATAKKCNGOF-UHFFFAOYSA-N |
| Punti di ebollizione | 65.0°C |
| Punto d'infiammabilità | −21°C |
| Gravità specifica | 0.9 |
| PubChem CID | 2733832 |
| Formula molecolare | C6H18LiNSi2 |
| Informazioni di solubilità | Solubility in water: reacts. |
| Fieser | 04,296; 05,393; 07,197; 12,280; 13,165; 14,194 |
| CAS | 109-99-9 |
| Materiale o nome chimico | Lithium bis(trimethylsilyl)amide |
| IUPAC Name | lithium;bis(trimethylsilyl)azanide |
| EINECS Number | 223-725-6 |
3-(Trimethoxysilyl)propyl methacrylate, 98%
CAS: 2530-85-0 Formula molecolare: C10H20O5Si Molecular Weight (g/mol): 248.35 Numero MDL: MFCD00008593 InChI Key: XDLMVUHYZWKMMD-UHFFFAOYSA-N Sinonimo: 3-trimethoxysilyl propyl methacrylate,3-methacryloxypropyltrimethoxysilane,methacryloxypropyltrimethoxysilane,dynasylan memo,silicone a-174,union carbide a-174,mops-m,silane a-174,nuca 174,2-propenoic acid, 2-methyl-, 3-trimethoxysilyl propyl ester PubChem CID: 17318 IUPAC Name: 3-trimethoxysilylpropyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCCC[Si](OC)(OC)OC
| Sinonimo | 3-trimethoxysilyl propyl methacrylate,3-methacryloxypropyltrimethoxysilane,methacryloxypropyltrimethoxysilane,dynasylan memo,silicone a-174,union carbide a-174,mops-m,silane a-174,nuca 174,2-propenoic acid, 2-methyl-, 3-trimethoxysilyl propyl ester |
|---|---|
| Numero MDL | MFCD00008593 |
| PubChem CID | 17318 |
| Formula molecolare | C10H20O5Si |
| CAS | 2530-85-0 |
| Molecular Weight (g/mol) | 248.35 |
| SMILES | CC(=C)C(=O)OCCC[Si](OC)(OC)OC |
| IUPAC Name | 3-trimethoxysilylpropyl 2-methylprop-2-enoate |
| InChI Key | XDLMVUHYZWKMMD-UHFFFAOYSA-N |
Diisobutylaluminium hydride, 1.2M (20 wt%) solution in toluene, AcroSeal™
CAS: 1191-15-7 | C8H19Al | 142.22 g/mol
| Peso formulazione | 142.22 |
|---|---|
| Sinonimo | DIBAL-H |
| Numero MDL | MFCD00008928 |
| Formula lineare | [(CH3)2CHCH2]2AIH |
| Pericolo per la salute 1 | GHS Signal Word: Danger |
| Pericolo per la salute 2 | GHS H Statement Causes severe skin burns and eye damage. May be fatal if swallowed and enters airways. May cause damage to organs through prolonged or repeated exposure. Suspected of damaging the unborn child. May cause dro |
| Pericolo per la salute 3 | GHS P Statement IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsi |
| Forma fisica | Solution |
| Molecular Weight (g/mol) | 142.22 |
| Densità | 0.8480g/mL |
| Punti di ebollizione | 110.0°C |
| Punto d'infiammabilità | 4°C |
| Gravità specifica | 0.848 |
| Formula molecolare | C8H19Al |
| Informazioni di solubilità | Solubility in water: reacts violently. Other solubilities: miscible with saturated aliphatic and aromatic,hydrocarbons |
| Fieser | 01,260; 02,140; 03,101; 04,158; 05,224; 06,198; 07,111; 08,173; 09,171; 10,149; 11,185; 12,191; 13,115; 14,138; 15,137; 16,27; 17,123 |
| CAS | 108-88-3 |
| Indice di Merck | 15, 3212 |
| Materiale o nome chimico | Diisobutylaluminium hydride |
| Beilstein | 04, IV, 4400 |
| EINECS Number | 214-729-9 |
3-Aminopropyltriethoxysilane, 99%
CAS: 919-30-2 Formula molecolare: C9H23NO3Si Molecular Weight (g/mol): 221.37 Numero MDL: MFCD00008207,MFCD01324904 InChI Key: WYTZZXDRDKSJID-UHFFFAOYSA-N Sinonimo: 3-aminopropyltriethoxysilane,3-aminopropyl triethoxysilane,aptes,3-triethoxysilyl propan-1-amine,1-propanamine, 3-triethoxysilyl,silicone a-1100,silane 1100,3-triethoxysilyl propylamine,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane PubChem CID: 13521 IUPAC Name: 3-triethoxysilylpropan-1-amine SMILES: CCO[Si](CCCN)(OCC)OCC
| Sinonimo | 3-aminopropyltriethoxysilane,3-aminopropyl triethoxysilane,aptes,3-triethoxysilyl propan-1-amine,1-propanamine, 3-triethoxysilyl,silicone a-1100,silane 1100,3-triethoxysilyl propylamine,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane |
|---|---|
| Numero MDL | MFCD00008207,MFCD01324904 |
| PubChem CID | 13521 |
| Formula molecolare | C9H23NO3Si |
| CAS | 919-30-2 |
| Molecular Weight (g/mol) | 221.37 |
| SMILES | CCO[Si](CCCN)(OCC)OCC |
| IUPAC Name | 3-triethoxysilylpropan-1-amine |
| InChI Key | WYTZZXDRDKSJID-UHFFFAOYSA-N |
N,O-Bis(trimethylsilyl)trifluoroacetamide, with 1% trimethylsilyl chloride
CAS: 25561-30-2 Formula molecolare: C8H18F3NOSi2 Molecular Weight (g/mol): 257.4 Numero MDL: MFCD00008269 InChI Key: XCOBLONWWXQEBS-GHXNOFRVSA-N Sinonimo: bstfa,n,o-bis trimethylsilyl trifluoroacetamide,acetamide, 2,2,2-trifluoro-o,n-bis trimethylsilyl,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl acetimidate,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanimidate,trimethylsilyl 1z-2,2,2-trifluoro-n-z-trimethylsilyl ethanimidoate #,n,o-bis trimethylsilyl trifluoroacetamide bstfa,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanecarboximidate PubChem CID: 9601896 IUPAC Name: trimethylsilyl (1Z)-2,2,2-trifluoro-N-trimethylsilylethanimidate SMILES: C[Si](C)(C)N=C(C(F)(F)F)O[Si](C)(C)C
| Sinonimo | bstfa,n,o-bis trimethylsilyl trifluoroacetamide,acetamide, 2,2,2-trifluoro-o,n-bis trimethylsilyl,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl acetimidate,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanimidate,trimethylsilyl 1z-2,2,2-trifluoro-n-z-trimethylsilyl ethanimidoate #,n,o-bis trimethylsilyl trifluoroacetamide bstfa,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanecarboximidate |
|---|---|
| Numero MDL | MFCD00008269 |
| PubChem CID | 9601896 |
| Formula molecolare | C8H18F3NOSi2 |
| CAS | 25561-30-2 |
| Molecular Weight (g/mol) | 257.4 |
| SMILES | C[Si](C)(C)N=C(C(F)(F)F)O[Si](C)(C)C |
| IUPAC Name | trimethylsilyl (1Z)-2,2,2-trifluoro-N-trimethylsilylethanimidate |
| InChI Key | XCOBLONWWXQEBS-GHXNOFRVSA-N |
Copper(II) acetylacetonate, 98%
CAS: 13395-16-9 Formula molecolare: C10H14CuO4 Molecular Weight (g/mol): 261.76 Numero MDL: MFCD00000016 InChI Key: QYJPSWYYEKYVEJ-FDGPNNRMSA-L Sinonimo: 2, 4-Pentanedione, metal derivative,Cupric acetylacetonate IUPAC Name: copper(2+) bis((2Z)-4-oxopent-2-en-2-olate) SMILES: [Cu++].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O
Gli ordini eseguiti prima delle 14:00 saranno spediti oggi stesso. Gli ordini eseguiti dopo le 14:00 saranno spediti domani.
Per saperne di più
| Sinonimo | 2, 4-Pentanedione, metal derivative,Cupric acetylacetonate |
|---|---|
| Numero MDL | MFCD00000016 |
| Formula molecolare | C10H14CuO4 |
| CAS | 13395-16-9 |
| Molecular Weight (g/mol) | 261.76 |
| SMILES | [Cu++].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O |
| IUPAC Name | copper(2+) bis((2Z)-4-oxopent-2-en-2-olate) |
| InChI Key | QYJPSWYYEKYVEJ-FDGPNNRMSA-L |
Chlorotrimethylsilane, 98%
CAS: 75-77-4 Formula molecolare: C3H9ClSi Molecular Weight (g/mol): 108.64 Numero MDL: MFCD00000502 InChI Key: IJOOHPMOJXWVHK-UHFFFAOYSA-N Sinonimo: trimethylchlorosilane,trimethylsilyl chloride,silane, chlorotrimethyl,trimethyl chlorosilane,monochlorotrimethylsilicon,tmcs,chloro trimethyl silane,silane, trimethylchloro,silicane, chlorotrimethyl,tmscl PubChem CID: 6397 ChEBI: CHEBI:85069 IUPAC Name: chloro(trimethyl)silane SMILES: C[Si](C)(C)Cl
| Sinonimo | trimethylchlorosilane,trimethylsilyl chloride,silane, chlorotrimethyl,trimethyl chlorosilane,monochlorotrimethylsilicon,tmcs,chloro trimethyl silane,silane, trimethylchloro,silicane, chlorotrimethyl,tmscl |
|---|---|
| Numero MDL | MFCD00000502 |
| PubChem CID | 6397 |
| Formula molecolare | C3H9ClSi |
| CAS | 75-77-4 |
| Molecular Weight (g/mol) | 108.64 |
| ChEBI | CHEBI:85069 |
| SMILES | C[Si](C)(C)Cl |
| IUPAC Name | chloro(trimethyl)silane |
| InChI Key | IJOOHPMOJXWVHK-UHFFFAOYSA-N |
Hexamethyldisiloxane, 98+%
CAS: 107-46-0 InChI Key: UQEAIHBTYFGYIE-UHFFFAOYSA-N Sinonimo: hexamethyldisiloxane,disiloxane, hexamethyl,hexamethyl disiloxane,oxybis trimethylsilane,fluka ag,hmdso,bis trimethylsilyl ether,belsil dm 0.65,bis trimethylsilyl oxide PubChem CID: 24764 ChEBI: CHEBI:78002 IUPAC Name: trimethyl(trimethylsilyloxy)silane SMILES: C[Si](C)(C)O[Si](C)(C)C
| Sinonimo | hexamethyldisiloxane,disiloxane, hexamethyl,hexamethyl disiloxane,oxybis trimethylsilane,fluka ag,hmdso,bis trimethylsilyl ether,belsil dm 0.65,bis trimethylsilyl oxide |
|---|---|
| PubChem CID | 24764 |
| CAS | 107-46-0 |
| ChEBI | CHEBI:78002 |
| SMILES | C[Si](C)(C)O[Si](C)(C)C |
| IUPAC Name | trimethyl(trimethylsilyloxy)silane |
| InChI Key | UQEAIHBTYFGYIE-UHFFFAOYSA-N |
Tetraethyl orthosilicate, 98%
CAS: 78-10-4 Formula molecolare: C8H20O4Si Molecular Weight (g/mol): 208.33 Numero MDL: MFCD00009062 InChI Key: BOTDANWDWHJENH-UHFFFAOYSA-N Sinonimo: tetraethyl orthosilicate,tetraethoxysilane,teos,ethyl silicate,silicon ethoxide,silicon tetraethoxide,silane, tetraethoxy,dynasil a,tetraethoxysilicon,ethyl orthosilicate PubChem CID: 6517 IUPAC Name: tetraethyl silicate SMILES: CCO[Si](OCC)(OCC)OCC
| Sinonimo | tetraethyl orthosilicate,tetraethoxysilane,teos,ethyl silicate,silicon ethoxide,silicon tetraethoxide,silane, tetraethoxy,dynasil a,tetraethoxysilicon,ethyl orthosilicate |
|---|---|
| Numero MDL | MFCD00009062 |
| PubChem CID | 6517 |
| Formula molecolare | C8H20O4Si |
| CAS | 78-10-4 |
| Molecular Weight (g/mol) | 208.33 |
| SMILES | CCO[Si](OCC)(OCC)OCC |
| IUPAC Name | tetraethyl silicate |
| InChI Key | BOTDANWDWHJENH-UHFFFAOYSA-N |
Tetraethyl orthosilicate, 98%, AcroSeal™
CAS: 78-10-4 Formula molecolare: C8H20O4Si Molecular Weight (g/mol): 208.33 InChI Key: BOTDANWDWHJENH-UHFFFAOYSA-N Sinonimo: tetraethyl orthosilicate,tetraethoxysilane,teos,ethyl silicate,silicon ethoxide,silicon tetraethoxide,silane, tetraethoxy,dynasil a,tetraethoxysilicon,ethyl orthosilicate PubChem CID: 6517 IUPAC Name: tetraethyl silicate SMILES: CCO[Si](OCC)(OCC)OCC
| Sinonimo | tetraethyl orthosilicate,tetraethoxysilane,teos,ethyl silicate,silicon ethoxide,silicon tetraethoxide,silane, tetraethoxy,dynasil a,tetraethoxysilicon,ethyl orthosilicate |
|---|---|
| PubChem CID | 6517 |
| Formula molecolare | C8H20O4Si |
| CAS | 78-10-4 |
| Molecular Weight (g/mol) | 208.33 |
| SMILES | CCO[Si](OCC)(OCC)OCC |
| IUPAC Name | tetraethyl silicate |
| InChI Key | BOTDANWDWHJENH-UHFFFAOYSA-N |
| Peso formulazione | 121.99 |
|---|---|
| Sinonimo | sodium triethylborohydride,sodium triethylborate,sodium triethylhydroborate,sodium triethylhydridoborate,sodium triethylhydroborate 1-,sodium triethylborohydride solution,sodium triethyl-? 2-boranuide,sodiumtriethylborohydride 1m in toluene |
| Numero MDL | MFCD00011704 |
| Formula lineare | NaB(C2H5)3H |
| Pericolo per la salute 1 | GHS Signal Word: Danger |
| Nota nome | 1M solution in THF |
| Colore | Colorless |
| Pericolo per la salute 2 | GHS H Statement Causes severe skin burns and eye damage. May cause respiratory irritation. In contact with water releases flammable gas. Highly flammable liquid and vapor. May form explosive peroxides. Reacts violentl |
| Pericolo per la salute 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. Handle under inert gas. Protect from moisture |
| Forma fisica | Solution |
| Molecular Weight (g/mol) | 121.99 |
| SMILES | [Na+].CC[BH-](CC)CC |
| Densità | 0.8900g/mL |
| InChI Key | YDTZLEUIYNMRLQ-UHFFFAOYSA-N |
| Punto d'infiammabilità | −17°C |
| Gravità specifica | 0.89 |
| Imballaggio | AcroSeal™ Glass bottle |
| PubChem CID | 23667700 |
| Formula molecolare | C6H16BNa |
| Informazioni di solubilità | Solubility in water: rzacts. |
| CAS | 109-99-9 |
| Materiale o nome chimico | Sodium triethylborohydride |
| IUPAC Name | sodium;triethylboron(1-) |
| EINECS Number | 241-903-1 |
3-Aminopropyltriethoxysilane, 99%, AcroSeal™
CAS: 919-30-2 Formula molecolare: C9H23NO3Si Molecular Weight (g/mol): 221.37 Numero MDL: MFCD00008207,MFCD01324904 InChI Key: WYTZZXDRDKSJID-UHFFFAOYSA-N Sinonimo: 3-aminopropyltriethoxysilane,3-aminopropyl triethoxysilane,aptes,3-triethoxysilyl propan-1-amine,1-propanamine, 3-triethoxysilyl,silicone a-1100,silane 1100,3-triethoxysilyl propylamine,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane PubChem CID: 13521 IUPAC Name: 3-triethoxysilylpropan-1-amine SMILES: CCO[Si](CCCN)(OCC)OCC
| Sinonimo | 3-aminopropyltriethoxysilane,3-aminopropyl triethoxysilane,aptes,3-triethoxysilyl propan-1-amine,1-propanamine, 3-triethoxysilyl,silicone a-1100,silane 1100,3-triethoxysilyl propylamine,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane |
|---|---|
| Numero MDL | MFCD00008207,MFCD01324904 |
| PubChem CID | 13521 |
| Formula molecolare | C9H23NO3Si |
| CAS | 919-30-2 |
| Molecular Weight (g/mol) | 221.37 |
| SMILES | CCO[Si](CCCN)(OCC)OCC |
| IUPAC Name | 3-triethoxysilylpropan-1-amine |
| InChI Key | WYTZZXDRDKSJID-UHFFFAOYSA-N |
Octadecyltrichlorosilane, 95%
CAS: 112-04-9 Formula molecolare: C18H37Cl3Si Molecular Weight (g/mol): 387.94 Numero MDL: MFCD00000484 InChI Key: PYJJCSYBSYXGQQ-UHFFFAOYSA-N Sinonimo: octadecyltrichlorosilane,trichloro octadecyl silane,n-octadecyltrichlorosilane,silane, trichlorooctadecyl,silane, octadecyltrichloro,n-octadecyl trichlorosilane,stearyltrichlorosilane,unii-1qle771pke,trichlorostearylsilane,trichloroctadecylsilane PubChem CID: 8157 IUPAC Name: trichloro(octadecyl)silane SMILES: CCCCCCCCCCCCCCCCCC[Si](Cl)(Cl)Cl
| Sinonimo | octadecyltrichlorosilane,trichloro octadecyl silane,n-octadecyltrichlorosilane,silane, trichlorooctadecyl,silane, octadecyltrichloro,n-octadecyl trichlorosilane,stearyltrichlorosilane,unii-1qle771pke,trichlorostearylsilane,trichloroctadecylsilane |
|---|---|
| Numero MDL | MFCD00000484 |
| PubChem CID | 8157 |
| Formula molecolare | C18H37Cl3Si |
| CAS | 112-04-9 |
| Molecular Weight (g/mol) | 387.94 |
| SMILES | CCCCCCCCCCCCCCCCCC[Si](Cl)(Cl)Cl |
| IUPAC Name | trichloro(octadecyl)silane |
| InChI Key | PYJJCSYBSYXGQQ-UHFFFAOYSA-N |