Risultati della ricerca filtrata
Copper(II) acetylacetonate, 98%
CAS: 13395-16-9 Formula molecolare: C10H14CuO4 Molecular Weight (g/mol): 261.76 Numero MDL: MFCD00000016 InChI Key: QYJPSWYYEKYVEJ-FDGPNNRMSA-L Sinonimo: 2, 4-Pentanedione, metal derivative,Cupric acetylacetonate IUPAC Name: copper(2+) bis((2Z)-4-oxopent-2-en-2-olate) SMILES: [Cu++].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O
Gli ordini eseguiti prima delle 14:00 saranno spediti oggi stesso. Gli ordini eseguiti dopo le 14:00 saranno spediti domani.
Per saperne di più
| Sinonimo | 2, 4-Pentanedione, metal derivative,Cupric acetylacetonate |
|---|---|
| Numero MDL | MFCD00000016 |
| Formula molecolare | C10H14CuO4 |
| CAS | 13395-16-9 |
| Molecular Weight (g/mol) | 261.76 |
| SMILES | [Cu++].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O |
| IUPAC Name | copper(2+) bis((2Z)-4-oxopent-2-en-2-olate) |
| InChI Key | QYJPSWYYEKYVEJ-FDGPNNRMSA-L |
Sodium tetraethylborate, 97%, pure, Thermo Scientific Chemicals
CAS: 15523-24-7 Formula molecolare: C8H20BNa Molecular Weight (g/mol): 150.04 Numero MDL: MFCD00061547 InChI Key: SZSBMTRYJRHYNI-UHFFFAOYSA-N Sinonimo: sodium tetraethylborate,sodium tetraethylboranuide,borate 1-,tetraethyl-, sodium 1:1,sodium tetraethylborate 1-,et4bna,sodiotetraethylboron v,borate 1-, tetraethyl-, sodium,sodium tetraethylborate 1g PubChem CID: 23681030 IUPAC Name: sodium;tetraethylboranuide SMILES: [B-](CC)(CC)(CC)CC.[Na+]
| Sinonimo | sodium tetraethylborate,sodium tetraethylboranuide,borate 1-,tetraethyl-, sodium 1:1,sodium tetraethylborate 1-,et4bna,sodiotetraethylboron v,borate 1-, tetraethyl-, sodium,sodium tetraethylborate 1g |
|---|---|
| Numero MDL | MFCD00061547 |
| PubChem CID | 23681030 |
| Formula molecolare | C8H20BNa |
| CAS | 15523-24-7 |
| Molecular Weight (g/mol) | 150.04 |
| SMILES | [B-](CC)(CC)(CC)CC.[Na+] |
| IUPAC Name | sodium;tetraethylboranuide |
| InChI Key | SZSBMTRYJRHYNI-UHFFFAOYSA-N |
Hexamethyldisiloxane, 98+%
CAS: 107-46-0 InChI Key: UQEAIHBTYFGYIE-UHFFFAOYSA-N Sinonimo: hexamethyldisiloxane,disiloxane, hexamethyl,hexamethyl disiloxane,oxybis trimethylsilane,fluka ag,hmdso,bis trimethylsilyl ether,belsil dm 0.65,bis trimethylsilyl oxide PubChem CID: 24764 ChEBI: CHEBI:78002 IUPAC Name: trimethyl(trimethylsilyloxy)silane SMILES: C[Si](C)(C)O[Si](C)(C)C
| Sinonimo | hexamethyldisiloxane,disiloxane, hexamethyl,hexamethyl disiloxane,oxybis trimethylsilane,fluka ag,hmdso,bis trimethylsilyl ether,belsil dm 0.65,bis trimethylsilyl oxide |
|---|---|
| PubChem CID | 24764 |
| CAS | 107-46-0 |
| ChEBI | CHEBI:78002 |
| SMILES | C[Si](C)(C)O[Si](C)(C)C |
| IUPAC Name | trimethyl(trimethylsilyloxy)silane |
| InChI Key | UQEAIHBTYFGYIE-UHFFFAOYSA-N |
Chlorotrimethylsilane, 98%
CAS: 75-77-4 Formula molecolare: C3H9ClSi Molecular Weight (g/mol): 108.64 Numero MDL: MFCD00000502 InChI Key: IJOOHPMOJXWVHK-UHFFFAOYSA-N Sinonimo: trimethylchlorosilane,trimethylsilyl chloride,silane, chlorotrimethyl,trimethyl chlorosilane,monochlorotrimethylsilicon,tmcs,chloro trimethyl silane,silane, trimethylchloro,silicane, chlorotrimethyl,tmscl PubChem CID: 6397 ChEBI: CHEBI:85069 IUPAC Name: chloro(trimethyl)silane SMILES: C[Si](C)(C)Cl
| Sinonimo | trimethylchlorosilane,trimethylsilyl chloride,silane, chlorotrimethyl,trimethyl chlorosilane,monochlorotrimethylsilicon,tmcs,chloro trimethyl silane,silane, trimethylchloro,silicane, chlorotrimethyl,tmscl |
|---|---|
| Numero MDL | MFCD00000502 |
| PubChem CID | 6397 |
| Formula molecolare | C3H9ClSi |
| CAS | 75-77-4 |
| Molecular Weight (g/mol) | 108.64 |
| ChEBI | CHEBI:85069 |
| SMILES | C[Si](C)(C)Cl |
| IUPAC Name | chloro(trimethyl)silane |
| InChI Key | IJOOHPMOJXWVHK-UHFFFAOYSA-N |
Tetraethyl orthosilicate, 98%
CAS: 78-10-4 Formula molecolare: C8H20O4Si Molecular Weight (g/mol): 208.33 Numero MDL: MFCD00009062 InChI Key: BOTDANWDWHJENH-UHFFFAOYSA-N Sinonimo: tetraethyl orthosilicate,tetraethoxysilane,teos,ethyl silicate,silicon ethoxide,silicon tetraethoxide,silane, tetraethoxy,dynasil a,tetraethoxysilicon,ethyl orthosilicate PubChem CID: 6517 IUPAC Name: tetraethyl silicate SMILES: CCO[Si](OCC)(OCC)OCC
| Sinonimo | tetraethyl orthosilicate,tetraethoxysilane,teos,ethyl silicate,silicon ethoxide,silicon tetraethoxide,silane, tetraethoxy,dynasil a,tetraethoxysilicon,ethyl orthosilicate |
|---|---|
| Numero MDL | MFCD00009062 |
| PubChem CID | 6517 |
| Formula molecolare | C8H20O4Si |
| CAS | 78-10-4 |
| Molecular Weight (g/mol) | 208.33 |
| SMILES | CCO[Si](OCC)(OCC)OCC |
| IUPAC Name | tetraethyl silicate |
| InChI Key | BOTDANWDWHJENH-UHFFFAOYSA-N |
| Peso formulazione | 121.99 |
|---|---|
| Sinonimo | sodium triethylborohydride,sodium triethylborate,sodium triethylhydroborate,sodium triethylhydridoborate,sodium triethylhydroborate 1-,sodium triethylborohydride solution,sodium triethyl-? 2-boranuide,sodiumtriethylborohydride 1m in toluene |
| Numero MDL | MFCD00011704 |
| Formula lineare | NaB(C2H5)3H |
| Pericolo per la salute 1 | GHS Signal Word: Danger |
| Nota nome | 1M solution in THF |
| Colore | Colorless |
| Pericolo per la salute 2 | GHS H Statement Causes severe skin burns and eye damage. May cause respiratory irritation. In contact with water releases flammable gas. Highly flammable liquid and vapor. May form explosive peroxides. Reacts violentl |
| Pericolo per la salute 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. Handle under inert gas. Protect from moisture |
| Forma fisica | Solution |
| Molecular Weight (g/mol) | 121.99 |
| SMILES | [Na+].CC[BH-](CC)CC |
| Densità | 0.8900g/mL |
| InChI Key | YDTZLEUIYNMRLQ-UHFFFAOYSA-N |
| Punto d'infiammabilità | −17°C |
| Gravità specifica | 0.89 |
| Imballaggio | AcroSeal™ Glass bottle |
| PubChem CID | 23667700 |
| Formula molecolare | C6H16BNa |
| Informazioni di solubilità | Solubility in water: rzacts. |
| CAS | 109-99-9 |
| Materiale o nome chimico | Sodium triethylborohydride |
| IUPAC Name | sodium;triethylboron(1-) |
| EINECS Number | 241-903-1 |
Lithium bis(trimethylsilyl)amide, 1M solution in THF, AcroSeal™
CAS: 4039-32-1 | C6H18LiNSi2 | 167.33 g/mol
| Peso formulazione | 167.33 |
|---|---|
| Sinonimo | lithium bis trimethylsilyl amide,lithium hexamethyldisilazide,lihmds,lhmds,hexamethyldisilazane lithium salt,unii-rc4n1i108m,lithiumbis trimethylsilyl amide,lithium bis trimethylsilyl azanide,lithium hexamethyldisilazane,lithium bis-trimethylsilyl amide |
| Formula lineare | ((CH3)3Si)2NLi |
| Pericolo per la salute 1 | GHS Signal Word: Danger |
| Pericolo per la salute 2 | GHS H Statement Highly flammable liquid and vapor. Causes severe skin burns and eye damage. May cause respiratory irritation. Suspected of causing cancer. May form explosive peroxides. Reacts violently with water.<br/ |
| Pericolo per la salute 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. Wear protective gloves/protective clothing/eye p |
| Molecular Weight (g/mol) | 167.33 |
| SMILES | [Li+].C[Si](C)(C)[N-][Si](C)(C)C |
| Densità | 0.9000g/mL |
| InChI Key | YNESATAKKCNGOF-UHFFFAOYSA-N |
| Punti di ebollizione | 65.0°C |
| Punto d'infiammabilità | −21°C |
| Gravità specifica | 0.9 |
| PubChem CID | 2733832 |
| Formula molecolare | C6H18LiNSi2 |
| Informazioni di solubilità | Solubility in water: reacts. |
| Fieser | 04,296; 05,393; 07,197; 12,280; 13,165; 14,194 |
| CAS | 109-99-9 |
| Materiale o nome chimico | Lithium bis(trimethylsilyl)amide |
| IUPAC Name | lithium;bis(trimethylsilyl)azanide |
| EINECS Number | 223-725-6 |
3-Aminopropyltriethoxysilane, 99%, AcroSeal™
CAS: 919-30-2 Formula molecolare: C9H23NO3Si Molecular Weight (g/mol): 221.37 Numero MDL: MFCD00008207,MFCD01324904 InChI Key: WYTZZXDRDKSJID-UHFFFAOYSA-N Sinonimo: 3-aminopropyltriethoxysilane,3-aminopropyl triethoxysilane,aptes,3-triethoxysilyl propan-1-amine,1-propanamine, 3-triethoxysilyl,silicone a-1100,silane 1100,3-triethoxysilyl propylamine,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane PubChem CID: 13521 IUPAC Name: 3-triethoxysilylpropan-1-amine SMILES: CCO[Si](CCCN)(OCC)OCC
| Sinonimo | 3-aminopropyltriethoxysilane,3-aminopropyl triethoxysilane,aptes,3-triethoxysilyl propan-1-amine,1-propanamine, 3-triethoxysilyl,silicone a-1100,silane 1100,3-triethoxysilyl propylamine,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane |
|---|---|
| Numero MDL | MFCD00008207,MFCD01324904 |
| PubChem CID | 13521 |
| Formula molecolare | C9H23NO3Si |
| CAS | 919-30-2 |
| Molecular Weight (g/mol) | 221.37 |
| SMILES | CCO[Si](CCCN)(OCC)OCC |
| IUPAC Name | 3-triethoxysilylpropan-1-amine |
| InChI Key | WYTZZXDRDKSJID-UHFFFAOYSA-N |
Dichlorodimethylsilane, 99+%, AcroSeal™
CAS: 75-78-5 Formula molecolare: C2H6Cl2Si Molecular Weight (g/mol): 129.06 Numero MDL: MFCD00000491 InChI Key: LIKFHECYJZWXFJ-UHFFFAOYSA-N Sinonimo: dimethyldichlorosilane,silane, dichlorodimethyl,dichloro dimethyl silane,inerton aw-dmcs,dichlorodimethylsilicon,dimethyl-dichlorsilan,inerton dw-dmc,repel-silan,dimethylsilane dichloride,dimethyl dichlorosilane PubChem CID: 6398 IUPAC Name: dichloro(dimethyl)silane SMILES: C[Si](C)(Cl)Cl
| Sinonimo | dimethyldichlorosilane,silane, dichlorodimethyl,dichloro dimethyl silane,inerton aw-dmcs,dichlorodimethylsilicon,dimethyl-dichlorsilan,inerton dw-dmc,repel-silan,dimethylsilane dichloride,dimethyl dichlorosilane |
|---|---|
| Numero MDL | MFCD00000491 |
| PubChem CID | 6398 |
| Formula molecolare | C2H6Cl2Si |
| CAS | 75-78-5 |
| Molecular Weight (g/mol) | 129.06 |
| SMILES | C[Si](C)(Cl)Cl |
| IUPAC Name | dichloro(dimethyl)silane |
| InChI Key | LIKFHECYJZWXFJ-UHFFFAOYSA-N |
3-Aminopropyltriethoxysilane, 99%
CAS: 919-30-2 Formula molecolare: C9H23NO3Si Molecular Weight (g/mol): 221.37 Numero MDL: MFCD00008207,MFCD01324904 InChI Key: WYTZZXDRDKSJID-UHFFFAOYSA-N Sinonimo: 3-aminopropyltriethoxysilane,3-aminopropyl triethoxysilane,aptes,3-triethoxysilyl propan-1-amine,1-propanamine, 3-triethoxysilyl,silicone a-1100,silane 1100,3-triethoxysilyl propylamine,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane PubChem CID: 13521 IUPAC Name: 3-triethoxysilylpropan-1-amine SMILES: CCO[Si](CCCN)(OCC)OCC
| Sinonimo | 3-aminopropyltriethoxysilane,3-aminopropyl triethoxysilane,aptes,3-triethoxysilyl propan-1-amine,1-propanamine, 3-triethoxysilyl,silicone a-1100,silane 1100,3-triethoxysilyl propylamine,propylamine, 3-triethoxysilyl,triethoxy 3-aminopropyl silane |
|---|---|
| Numero MDL | MFCD00008207,MFCD01324904 |
| PubChem CID | 13521 |
| Formula molecolare | C9H23NO3Si |
| CAS | 919-30-2 |
| Molecular Weight (g/mol) | 221.37 |
| SMILES | CCO[Si](CCCN)(OCC)OCC |
| IUPAC Name | 3-triethoxysilylpropan-1-amine |
| InChI Key | WYTZZXDRDKSJID-UHFFFAOYSA-N |
Hexamethyldisilazane, 98+%
CAS: 999-97-3 Formula molecolare: C6H19NSi2 Molecular Weight (g/mol): 161.395 Numero MDL: MFCD00008259 InChI Key: FFUAGWLWBBFQJT-UHFFFAOYSA-N Sinonimo: hexamethyldisilazane,bis trimethylsilyl amine,hmds,1,1,1,3,3,3-hexamethyldisilazane,hexamethylsilazane,silanamine, 1,1,1-trimethyl-n-trimethylsilyl,tri-sil,1,1,1-trimethyl-n-trimethylsilyl silanamine,hexamethyldisilizane,disilazane, 1,1,1,3,3,3-hexamethyl PubChem CID: 13838 ChEBI: CHEBI:85068 IUPAC Name: [dimethyl-(trimethylsilylamino)silyl]methane SMILES: C[Si](C)(C)N[Si](C)(C)C
| Sinonimo | hexamethyldisilazane,bis trimethylsilyl amine,hmds,1,1,1,3,3,3-hexamethyldisilazane,hexamethylsilazane,silanamine, 1,1,1-trimethyl-n-trimethylsilyl,tri-sil,1,1,1-trimethyl-n-trimethylsilyl silanamine,hexamethyldisilizane,disilazane, 1,1,1,3,3,3-hexamethyl |
|---|---|
| Numero MDL | MFCD00008259 |
| PubChem CID | 13838 |
| Formula molecolare | C6H19NSi2 |
| CAS | 999-97-3 |
| Molecular Weight (g/mol) | 161.395 |
| ChEBI | CHEBI:85068 |
| SMILES | C[Si](C)(C)N[Si](C)(C)C |
| IUPAC Name | [dimethyl-(trimethylsilylamino)silyl]methane |
| InChI Key | FFUAGWLWBBFQJT-UHFFFAOYSA-N |
Lead(IV) acetate, 96% (dry wt.), stab. with 5-10% glacial acetic acid
CAS: 546-67-8 Formula molecolare: C8H16O8Pb Molecular Weight (g/mol): 447.408 Numero MDL: MFCD00008693 InChI Key: NVTAREBLATURGT-UHFFFAOYSA-N Sinonimo: lead iv acetate PubChem CID: 50931538 IUPAC Name: acetic acid;lead SMILES: CC(=O)O.CC(=O)O.CC(=O)O.CC(=O)O.[Pb]
| Sinonimo | lead iv acetate |
|---|---|
| Numero MDL | MFCD00008693 |
| PubChem CID | 50931538 |
| Formula molecolare | C8H16O8Pb |
| CAS | 546-67-8 |
| Molecular Weight (g/mol) | 447.408 |
| SMILES | CC(=O)O.CC(=O)O.CC(=O)O.CC(=O)O.[Pb] |
| IUPAC Name | acetic acid;lead |
| InChI Key | NVTAREBLATURGT-UHFFFAOYSA-N |
Diisobutylaluminium hydride, 1.2M (20 wt%) solution in toluene, AcroSeal™
CAS: 1191-15-7 | C8H19Al | 142.22 g/mol
| Peso formulazione | 142.22 |
|---|---|
| Sinonimo | DIBAL-H |
| Numero MDL | MFCD00008928 |
| Formula lineare | [(CH3)2CHCH2]2AIH |
| Pericolo per la salute 1 | GHS Signal Word: Danger |
| Pericolo per la salute 2 | GHS H Statement Causes severe skin burns and eye damage. May be fatal if swallowed and enters airways. May cause damage to organs through prolonged or repeated exposure. Suspected of damaging the unborn child. May cause dro |
| Pericolo per la salute 3 | GHS P Statement IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsi |
| Forma fisica | Solution |
| Molecular Weight (g/mol) | 142.22 |
| Densità | 0.8480g/mL |
| Punti di ebollizione | 110.0°C |
| Punto d'infiammabilità | 4°C |
| Gravità specifica | 0.848 |
| Formula molecolare | C8H19Al |
| Informazioni di solubilità | Solubility in water: reacts violently. Other solubilities: miscible with saturated aliphatic and aromatic,hydrocarbons |
| Fieser | 01,260; 02,140; 03,101; 04,158; 05,224; 06,198; 07,111; 08,173; 09,171; 10,149; 11,185; 12,191; 13,115; 14,138; 15,137; 16,27; 17,123 |
| CAS | 108-88-3 |
| Indice di Merck | 15, 3212 |
| Materiale o nome chimico | Diisobutylaluminium hydride |
| Beilstein | 04, IV, 4400 |
| EINECS Number | 214-729-9 |