Phenanthrenes and derivatives
- (1)
- (12)
- (1)
- (3)
- (2)
- (4)
- (7)
- (1)
- (8)
- (12)
- (2)
- (2)
- (1)
- (3)
- (3)
- (2)
- (6)
- (2)
- (2)
- (2)
- (1)
- (1)
- (2)
- (1)
- (3)
- (22)
- (1)
- (13)
- (2)
- (6)
- (14)
- (3)
- (12)
- (1)
- (5)
- (3)
- (6)
- (1)
- (8)
- (10)
- (6)
- (1)
- (8)
- (2)
- (4)
- (7)
- (14)
- (9)
- (4)
- (6)
- (3)
- (4)
- (3)
- (2)
- (2)
- (2)
- (2)
- (2)
- (2)
- (3)
- (26)
- (2)
- (2)
- (3)
- (3)
- (2)
- (2)
- (2)
- (2)
- (2)
- (15)
- (2)
- (1)
Risultati della ricerca filtrata
Fullerene C60, 99.9%
CAS: 99685-96-8 Formula molecolare: C60 Molecular Weight (g/mol): 720.66 Numero MDL: MFCD00151408 InChI Key: XMWRBQBLMFGWIX-UHFFFAOYSA-N Sinonimo: fullerene,buckminsterfullerene,buckyball,fullerene 60,60 fullerene,footballene,fullerene-c60,5,6 fullerene-c60-ih PubChem CID: 123591 ChEBI: CHEBI:33128 IUPAC Name: (C\{60}-I\{h})[5,6]fullerene SMILES: C12=C3C4=C5C1=C1C6=C7C2=C2C8=C3C3=C9C4=C4C%10=C5C5=C1C1=C6C6=C%11C7=C2C2=C7C8=C3C3=C8C9=C4C4=C9C%10=C5C5=C1C1=C6C6=C%11C2=C2C7=C3C3=C8C4=C4C9=C5C1=C1C6=C2C3=C41
Gli ordini eseguiti prima delle 14:00 saranno spediti oggi stesso. Gli ordini eseguiti dopo le 14:00 saranno spediti domani.
Per saperne di più
| Sinonimo | fullerene,buckminsterfullerene,buckyball,fullerene 60,60 fullerene,footballene,fullerene-c60,5,6 fullerene-c60-ih |
|---|---|
| Numero MDL | MFCD00151408 |
| PubChem CID | 123591 |
| Formula molecolare | C60 |
| CAS | 99685-96-8 |
| Molecular Weight (g/mol) | 720.66 |
| ChEBI | CHEBI:33128 |
| SMILES | C12=C3C4=C5C1=C1C6=C7C2=C2C8=C3C3=C9C4=C4C%10=C5C5=C1C1=C6C6=C%11C7=C2C2=C7C8=C3C3=C8C9=C4C4=C9C%10=C5C5=C1C1=C6C6=C%11C2=C2C7=C3C3=C8C4=C4C9=C5C1=C1C6=C2C3=C41 |
| IUPAC Name | (C\{60}-I\{h})[5,6]fullerene |
| InChI Key | XMWRBQBLMFGWIX-UHFFFAOYSA-N |
Rosin, gum
CAS: 8050-09-7 Formula molecolare: C20H30O2 Molecular Weight (g/mol): 302.46 Numero MDL: MFCD00132205 InChI Key: RSWGJHLUYNHPMX-UHFFFAOYNA-N Sinonimo: 4bs,1r,10ar,4ar-1,4a-dimethyl-7-methylethyl-1,2,3,4,5,6,10,10a,4a,4b-decah ydrophenanthrenecarboxylic acid,4ar-7-isopropyl-1,4a-dimethyl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylic acid
| Sinonimo | 4bs,1r,10ar,4ar-1,4a-dimethyl-7-methylethyl-1,2,3,4,5,6,10,10a,4a,4b-decah ydrophenanthrenecarboxylic acid,4ar-7-isopropyl-1,4a-dimethyl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylic acid |
|---|---|
| Numero MDL | MFCD00132205 |
| Formula molecolare | C20H30O2 |
| CAS | 8050-09-7 |
| Molecular Weight (g/mol) | 302.46 |
| InChI Key | RSWGJHLUYNHPMX-UHFFFAOYNA-N |
Phenanthrenequinone, 95%
CAS: 84-11-7 Formula molecolare: C14H8O2 Molecular Weight (g/mol): 208.22 Numero MDL: MFCD00001163 InChI Key: YYVYAPXYZVYDHN-UHFFFAOYSA-N Sinonimo: 9,10-phenanthrenequinone,phenanthrenequinone,9,10-phenanthrenedione,9,10-phenanthraquinone,phenanthraquinone,9,10-phenanthroquinone,9-10 phenanthrene quinone,unii-42l7bz8h74,ccris 7615,phenanthrene, 9,10-dihydro-9,10-dioxo PubChem CID: 6763 ChEBI: CHEBI:37454 IUPAC Name: phenanthrene-9,10-dione SMILES: C1=CC=C2C(=C1)C3=CC=CC=C3C(=O)C2=O
| Sinonimo | 9,10-phenanthrenequinone,phenanthrenequinone,9,10-phenanthrenedione,9,10-phenanthraquinone,phenanthraquinone,9,10-phenanthroquinone,9-10 phenanthrene quinone,unii-42l7bz8h74,ccris 7615,phenanthrene, 9,10-dihydro-9,10-dioxo |
|---|---|
| Numero MDL | MFCD00001163 |
| PubChem CID | 6763 |
| Formula molecolare | C14H8O2 |
| CAS | 84-11-7 |
| Molecular Weight (g/mol) | 208.22 |
| ChEBI | CHEBI:37454 |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3C(=O)C2=O |
| IUPAC Name | phenanthrene-9,10-dione |
| InChI Key | YYVYAPXYZVYDHN-UHFFFAOYSA-N |
(+)-Dehydroabietylamine hydrochloride
CAS: 16496-99-4 Formula molecolare: C20H32ClN Molecular Weight (g/mol): 321.93 Numero MDL: MFCD06795849 InChI Key: CVPQLGCAWUAYPF-UHFFFAOYNA-N Sinonimo: leelamine hydrochloride,dehydroabiethylamine hydrochloride,+-dehydroabietylamine,lylamine hydrochloride,nsc 2955 hydrochloride,+-dehydroabietylamine hydrochloride,+-dehydroabiethylamine hydrochloride,abieta-8,11,13-trien-18-amine-hydrogen chloride 1/1,13-isopropyl-podocarpa-8,11,13-trien-15-amine hydrochloride,1r,4as,10ar-7-isopropyl-1,4a-dimethyl-1,2,3,4,4a,9,10,10a-octahydrophenanthren-1-yl methanamine hydrochloride PubChem CID: 16759156 IUPAC Name: [(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methanamine;hydrochloride SMILES: Cl.CC(C)C1=CC2=C(C=C1)C1(C)CCCC(C)(CN)C1CC2
| Sinonimo | leelamine hydrochloride,dehydroabiethylamine hydrochloride,+-dehydroabietylamine,lylamine hydrochloride,nsc 2955 hydrochloride,+-dehydroabietylamine hydrochloride,+-dehydroabiethylamine hydrochloride,abieta-8,11,13-trien-18-amine-hydrogen chloride 1/1,13-isopropyl-podocarpa-8,11,13-trien-15-amine hydrochloride,1r,4as,10ar-7-isopropyl-1,4a-dimethyl-1,2,3,4,4a,9,10,10a-octahydrophenanthren-1-yl methanamine hydrochloride |
|---|---|
| Numero MDL | MFCD06795849 |
| PubChem CID | 16759156 |
| Formula molecolare | C20H32ClN |
| CAS | 16496-99-4 |
| Molecular Weight (g/mol) | 321.93 |
| SMILES | Cl.CC(C)C1=CC2=C(C=C1)C1(C)CCCC(C)(CN)C1CC2 |
| IUPAC Name | [(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methanamine;hydrochloride |
| InChI Key | CVPQLGCAWUAYPF-UHFFFAOYNA-N |
Rosin
CAS: 8050-09-7 Formula molecolare: C20H30O2 Molecular Weight (g/mol): 302.46 Numero MDL: MFCD00132205 InChI Key: RSWGJHLUYNHPMX-UHFFFAOYNA-N Sinonimo: 4bs,1r,10ar,4ar-1,4a-dimethyl-7-methylethyl-1,2,3,4,5,6,10,10a,4a,4b-decah ydrophenanthrenecarboxylic acid,4ar-7-isopropyl-1,4a-dimethyl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylic acid
| Sinonimo | 4bs,1r,10ar,4ar-1,4a-dimethyl-7-methylethyl-1,2,3,4,5,6,10,10a,4a,4b-decah ydrophenanthrenecarboxylic acid,4ar-7-isopropyl-1,4a-dimethyl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylic acid |
|---|---|
| Numero MDL | MFCD00132205 |
| Formula molecolare | C20H30O2 |
| CAS | 8050-09-7 |
| Molecular Weight (g/mol) | 302.46 |
| InChI Key | RSWGJHLUYNHPMX-UHFFFAOYNA-N |
Benzo[ghi]perylene, 98+%
CAS: 191-24-2 Formula molecolare: C22H12 Molecular Weight (g/mol): 276.33 Numero MDL: MFCD00004135 InChI Key: GYFAGKUZYNFMBN-UHFFFAOYSA-N Sinonimo: benzo ghi perylene,1,12-benzoperylene,1,12-benzperylene,benzo g,h,i perylene,benzo ghi pyrilene,benzo-1,12-perylene,unii-5zme2e2q9l,ccris 784 PubChem CID: 9117 ChEBI: CHEBI:34568 SMILES: C1=CC2=C3C(=C1)C4=CC=CC5=C4C6=C(C=C5)C=CC(=C36)C=C2
| Sinonimo | benzo ghi perylene,1,12-benzoperylene,1,12-benzperylene,benzo g,h,i perylene,benzo ghi pyrilene,benzo-1,12-perylene,unii-5zme2e2q9l,ccris 784 |
|---|---|
| Numero MDL | MFCD00004135 |
| PubChem CID | 9117 |
| Formula molecolare | C22H12 |
| CAS | 191-24-2 |
| Molecular Weight (g/mol) | 276.33 |
| ChEBI | CHEBI:34568 |
| SMILES | C1=CC2=C3C(=C1)C4=CC=CC5=C4C6=C(C=C5)C=CC(=C36)C=C2 |
| InChI Key | GYFAGKUZYNFMBN-UHFFFAOYSA-N |
Triphenylene, 98%
CAS: 217-59-4 Formula molecolare: C18H12 Molecular Weight (g/mol): 228.29 Numero MDL: MFCD00001108 InChI Key: SLGBZMMZGDRARJ-UHFFFAOYSA-N Sinonimo: 9,10-benzophenanthrene,isochrysene,9,10-benzphenanthrene,benzo l phenanthrene,1,2,3,4-dibenznaphthalene,benzophenanthrene,1,2:3,4-dibenznaphthalene,ccris 1301,triphenylen-1-yl PubChem CID: 9170 ChEBI: CHEBI:33080 IUPAC Name: triphenylene SMILES: C1=CC=C2C(=C1)C1=CC=CC=C1C1=CC=CC=C21
| Sinonimo | 9,10-benzophenanthrene,isochrysene,9,10-benzphenanthrene,benzo l phenanthrene,1,2,3,4-dibenznaphthalene,benzophenanthrene,1,2:3,4-dibenznaphthalene,ccris 1301,triphenylen-1-yl |
|---|---|
| Numero MDL | MFCD00001108 |
| PubChem CID | 9170 |
| Formula molecolare | C18H12 |
| CAS | 217-59-4 |
| Molecular Weight (g/mol) | 228.29 |
| ChEBI | CHEBI:33080 |
| SMILES | C1=CC=C2C(=C1)C1=CC=CC=C1C1=CC=CC=C21 |
| IUPAC Name | triphenylene |
| InChI Key | SLGBZMMZGDRARJ-UHFFFAOYSA-N |
Perfluoro(tetradecahydrophenanthrene), mixture of isomers, Thermo Scientific Chemicals
CAS: 306-91-2 Formula molecolare: C14F24 Molecular Weight (g/mol): 624.116 Numero MDL: MFCD00042596 InChI Key: QKENRHXGDUPTEM-UHFFFAOYSA-N Sinonimo: perfluorophenanthrene,perfluoroperhydrophenanthrene,flutec pp11,perfluoro perhydrophenanthrene,tetracosafluorotetradecahydrophenanthrene,phenanthrene, tetracosafluorotetradecahydro,phenanthrene, 1,1,2,2,3,3,4,4,4a,4b,5,5,6,6,7,7,8,8,8a,9,9,10,10,10a-tetracosafluorotetradecahydro,flutec tm pp11 r,acmc-1clkp,dsstox_cid_27029 PubChem CID: 78972 ChEBI: CHEBI:39423 IUPAC Name: 1,1,2,2,3,3,4,4,4a,4b,5,5,6,6,7,7,8,8,8a,9,9,10,10,10a-tetracosafluorophenanthrene SMILES: C12(C3(C(C(C(C1(C(C(C(C2(F)F)(F)F)(F)F)(F)F)F)(F)F)(F)F)(C(C(C(C3(F)F)(F)F)(F)F)(F)F)F)F)F
| Sinonimo | perfluorophenanthrene,perfluoroperhydrophenanthrene,flutec pp11,perfluoro perhydrophenanthrene,tetracosafluorotetradecahydrophenanthrene,phenanthrene, tetracosafluorotetradecahydro,phenanthrene, 1,1,2,2,3,3,4,4,4a,4b,5,5,6,6,7,7,8,8,8a,9,9,10,10,10a-tetracosafluorotetradecahydro,flutec tm pp11 r,acmc-1clkp,dsstox_cid_27029 |
|---|---|
| Numero MDL | MFCD00042596 |
| PubChem CID | 78972 |
| Formula molecolare | C14F24 |
| CAS | 306-91-2 |
| Molecular Weight (g/mol) | 624.116 |
| ChEBI | CHEBI:39423 |
| SMILES | C12(C3(C(C(C(C1(C(C(C(C2(F)F)(F)F)(F)F)(F)F)F)(F)F)(F)F)(C(C(C(C3(F)F)(F)F)(F)F)(F)F)F)F)F |
| IUPAC Name | 1,1,2,2,3,3,4,4,4a,4b,5,5,6,6,7,7,8,8,8a,9,9,10,10,10a-tetracosafluorophenanthrene |
| InChI Key | QKENRHXGDUPTEM-UHFFFAOYSA-N |
9,10-Phenanthrenequinone, 95%
CAS: 84-11-7 Formula molecolare: C14H8O2 Molecular Weight (g/mol): 208.216 Numero MDL: MFCD00001163 InChI Key: YYVYAPXYZVYDHN-UHFFFAOYSA-N Sinonimo: 9,10-phenanthrenequinone,phenanthrenequinone,9,10-phenanthrenedione,9,10-phenanthraquinone,phenanthraquinone,9,10-phenanthroquinone,9-10 phenanthrene quinone,unii-42l7bz8h74,ccris 7615,phenanthrene, 9,10-dihydro-9,10-dioxo PubChem CID: 6763 ChEBI: CHEBI:37454 IUPAC Name: phenanthrene-9,10-dione SMILES: C1=CC=C2C(=C1)C3=CC=CC=C3C(=O)C2=O
| Sinonimo | 9,10-phenanthrenequinone,phenanthrenequinone,9,10-phenanthrenedione,9,10-phenanthraquinone,phenanthraquinone,9,10-phenanthroquinone,9-10 phenanthrene quinone,unii-42l7bz8h74,ccris 7615,phenanthrene, 9,10-dihydro-9,10-dioxo |
|---|---|
| Numero MDL | MFCD00001163 |
| PubChem CID | 6763 |
| Formula molecolare | C14H8O2 |
| CAS | 84-11-7 |
| Molecular Weight (g/mol) | 208.216 |
| ChEBI | CHEBI:37454 |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3C(=O)C2=O |
| IUPAC Name | phenanthrene-9,10-dione |
| InChI Key | YYVYAPXYZVYDHN-UHFFFAOYSA-N |
Fullerene powder, hydroxylated, C{60}(OH)∣n,
CAS: 99685-96-8 Formula molecolare: C60 Molecular Weight (g/mol): 720.66 Numero MDL: MFCD06202029 InChI Key: XMWRBQBLMFGWIX-UHFFFAOYSA-N Sinonimo: fullerene,buckminsterfullerene,buckyball,fullerene 60,60 fullerene,footballene,fullerene-c60,5,6 fullerene-c60-ih PubChem CID: 123591 ChEBI: CHEBI:33128 IUPAC Name: (C\{60}-I\{h})[5,6]fullerene SMILES: C12=C3C4=C5C1=C1C6=C7C2=C2C8=C3C3=C9C4=C4C%10=C5C5=C1C1=C6C6=C%11C7=C2C2=C7C8=C3C3=C8C9=C4C4=C9C%10=C5C5=C1C1=C6C6=C%11C2=C2C7=C3C3=C8C4=C4C9=C5C1=C1C6=C2C3=C41
| Sinonimo | fullerene,buckminsterfullerene,buckyball,fullerene 60,60 fullerene,footballene,fullerene-c60,5,6 fullerene-c60-ih |
|---|---|
| Numero MDL | MFCD06202029 |
| PubChem CID | 123591 |
| Formula molecolare | C60 |
| CAS | 99685-96-8 |
| Molecular Weight (g/mol) | 720.66 |
| ChEBI | CHEBI:33128 |
| SMILES | C12=C3C4=C5C1=C1C6=C7C2=C2C8=C3C3=C9C4=C4C%10=C5C5=C1C1=C6C6=C%11C7=C2C2=C7C8=C3C3=C8C9=C4C4=C9C%10=C5C5=C1C1=C6C6=C%11C2=C2C7=C3C3=C8C4=C4C9=C5C1=C1C6=C2C3=C41 |
| IUPAC Name | (C\{60}-I\{h})[5,6]fullerene |
| InChI Key | XMWRBQBLMFGWIX-UHFFFAOYSA-N |
Triphenylene, 98%
CAS: 217-59-4 Formula molecolare: C18H12 Molecular Weight (g/mol): 228.29 Numero MDL: MFCD00001108 InChI Key: SLGBZMMZGDRARJ-UHFFFAOYSA-N Sinonimo: 9,10-benzophenanthrene,isochrysene,9,10-benzphenanthrene,benzo l phenanthrene,1,2,3,4-dibenznaphthalene,benzophenanthrene,1,2:3,4-dibenznaphthalene,ccris 1301,triphenylen-1-yl PubChem CID: 9170 ChEBI: CHEBI:33080 IUPAC Name: triphenylene SMILES: C1=CC=C2C(=C1)C1=CC=CC=C1C1=CC=CC=C21
| Sinonimo | 9,10-benzophenanthrene,isochrysene,9,10-benzphenanthrene,benzo l phenanthrene,1,2,3,4-dibenznaphthalene,benzophenanthrene,1,2:3,4-dibenznaphthalene,ccris 1301,triphenylen-1-yl |
|---|---|
| Numero MDL | MFCD00001108 |
| PubChem CID | 9170 |
| Formula molecolare | C18H12 |
| CAS | 217-59-4 |
| Molecular Weight (g/mol) | 228.29 |
| ChEBI | CHEBI:33080 |
| SMILES | C1=CC=C2C(=C1)C1=CC=CC=C1C1=CC=CC=C21 |
| IUPAC Name | triphenylene |
| InChI Key | SLGBZMMZGDRARJ-UHFFFAOYSA-N |
Fullerene powder, mixed refined, typically 70% C{60}, 28% C{70}, higher 2%
CAS: 99685-96-8 Formula molecolare: C60 Molecular Weight (g/mol): 720.66 Numero MDL: MFCD00282904 InChI Key: XMWRBQBLMFGWIX-UHFFFAOYSA-N Sinonimo: fullerene,buckminsterfullerene,buckyball,fullerene 60,60 fullerene,footballene,fullerene-c60,5,6 fullerene-c60-ih PubChem CID: 123591 ChEBI: CHEBI:33128 IUPAC Name: (C\{60}-I\{h})[5,6]fullerene SMILES: C12=C3C4=C5C1=C1C6=C7C2=C2C8=C3C3=C9C4=C4C%10=C5C5=C1C1=C6C6=C%11C7=C2C2=C7C8=C3C3=C8C9=C4C4=C9C%10=C5C5=C1C1=C6C6=C%11C2=C2C7=C3C3=C8C4=C4C9=C5C1=C1C6=C2C3=C41
| Sinonimo | fullerene,buckminsterfullerene,buckyball,fullerene 60,60 fullerene,footballene,fullerene-c60,5,6 fullerene-c60-ih |
|---|---|
| Numero MDL | MFCD00282904 |
| PubChem CID | 123591 |
| Formula molecolare | C60 |
| CAS | 99685-96-8 |
| Molecular Weight (g/mol) | 720.66 |
| ChEBI | CHEBI:33128 |
| SMILES | C12=C3C4=C5C1=C1C6=C7C2=C2C8=C3C3=C9C4=C4C%10=C5C5=C1C1=C6C6=C%11C7=C2C2=C7C8=C3C3=C8C9=C4C4=C9C%10=C5C5=C1C1=C6C6=C%11C2=C2C7=C3C3=C8C4=C4C9=C5C1=C1C6=C2C3=C41 |
| IUPAC Name | (C\{60}-I\{h})[5,6]fullerene |
| InChI Key | XMWRBQBLMFGWIX-UHFFFAOYSA-N |
Fullerene powder, 99.5% C{60}
CAS: 99685-96-8 Formula molecolare: C60 Molecular Weight (g/mol): 720.66 Numero MDL: MFCD00151408 InChI Key: XMWRBQBLMFGWIX-UHFFFAOYSA-N Sinonimo: fullerene,buckminsterfullerene,buckyball,fullerene 60,60 fullerene,footballene,fullerene-c60,5,6 fullerene-c60-ih PubChem CID: 123591 ChEBI: CHEBI:33128 IUPAC Name: (C\{60}-I\{h})[5,6]fullerene SMILES: C12=C3C4=C5C1=C1C6=C7C2=C2C8=C3C3=C9C4=C4C%10=C5C5=C1C1=C6C6=C%11C7=C2C2=C7C8=C3C3=C8C9=C4C4=C9C%10=C5C5=C1C1=C6C6=C%11C2=C2C7=C3C3=C8C4=C4C9=C5C1=C1C6=C2C3=C41
| Sinonimo | fullerene,buckminsterfullerene,buckyball,fullerene 60,60 fullerene,footballene,fullerene-c60,5,6 fullerene-c60-ih |
|---|---|
| Numero MDL | MFCD00151408 |
| PubChem CID | 123591 |
| Formula molecolare | C60 |
| CAS | 99685-96-8 |
| Molecular Weight (g/mol) | 720.66 |
| ChEBI | CHEBI:33128 |
| SMILES | C12=C3C4=C5C1=C1C6=C7C2=C2C8=C3C3=C9C4=C4C%10=C5C5=C1C1=C6C6=C%11C7=C2C2=C7C8=C3C3=C8C9=C4C4=C9C%10=C5C5=C1C1=C6C6=C%11C2=C2C7=C3C3=C8C4=C4C9=C5C1=C1C6=C2C3=C41 |
| IUPAC Name | (C\{60}-I\{h})[5,6]fullerene |
| InChI Key | XMWRBQBLMFGWIX-UHFFFAOYSA-N |
Coronene, 95%
CAS: 191-07-1 Formula molecolare: C24H12 Molecular Weight (g/mol): 300.36 Numero MDL: MFCD00004134 InChI Key: VPUGDVKSAQVFFS-UHFFFAOYSA-N Sinonimo: hexabenzobenzene,dibenzo ghi,pqr perylene,superbenzene,unii-7yy0x5xt1w,ccris 908,7yy0x5xt1w,6 circulene,coronene,acmc-209eul PubChem CID: 9115 ChEBI: CHEBI:29863 IUPAC Name: coronene SMILES: C1=CC2=CC=C3C=CC4=CC=C5C=CC6=CC=C1C1=C2C3=C4C5=C61
| Sinonimo | hexabenzobenzene,dibenzo ghi,pqr perylene,superbenzene,unii-7yy0x5xt1w,ccris 908,7yy0x5xt1w,6 circulene,coronene,acmc-209eul |
|---|---|
| Numero MDL | MFCD00004134 |
| PubChem CID | 9115 |
| Formula molecolare | C24H12 |
| CAS | 191-07-1 |
| Molecular Weight (g/mol) | 300.36 |
| ChEBI | CHEBI:29863 |
| SMILES | C1=CC2=CC=C3C=CC4=CC=C5C=CC6=CC=C1C1=C2C3=C4C5=C61 |
| IUPAC Name | coronene |
| InChI Key | VPUGDVKSAQVFFS-UHFFFAOYSA-N |
- Precedente
- 1
- 2
- 3
- 4
- Successivo