Risultati della ricerca filtrata
chlorodiisopropylphosphine, 96%
CAS: 40244-90-4 Formula molecolare: C6H14ClP Molecular Weight (g/mol): 152.61 Numero MDL: MFCD00015027 InChI Key: JZPDBTOWHLZQFC-UHFFFAOYSA-N Sinonimo: chlorodiisopropylphosphine,diisopropylchlorophosphine,di-i-propylchlorophosphine,phosphinous chloride, bis 1-methylethyl,ipr2pcl,pubchem6476,chlorodiisopropylphosphane,chloro diisopropylphosphine,acmc-209jc6,diisopropylphosphinyl chloride PubChem CID: 538967 IUPAC Name: chloro-di(propan-2-yl)phosphane SMILES: CC(C)P(C(C)C)Cl
| Sinonimo | chlorodiisopropylphosphine,diisopropylchlorophosphine,di-i-propylchlorophosphine,phosphinous chloride, bis 1-methylethyl,ipr2pcl,pubchem6476,chlorodiisopropylphosphane,chloro diisopropylphosphine,acmc-209jc6,diisopropylphosphinyl chloride |
|---|---|
| Numero MDL | MFCD00015027 |
| PubChem CID | 538967 |
| Formula molecolare | C6H14ClP |
| CAS | 40244-90-4 |
| Molecular Weight (g/mol) | 152.61 |
| SMILES | CC(C)P(C(C)C)Cl |
| IUPAC Name | chloro-di(propan-2-yl)phosphane |
| InChI Key | JZPDBTOWHLZQFC-UHFFFAOYSA-N |
Tetrabutylphosphonium hydroxide, 40 wt.% solution in water
CAS: 14518-69-5 | C16H37OP | 276.45 g/mol
Tri-n-butylphosphine, 95%
CAS: 998-40-3 Formula molecolare: C12H27P Molecular Weight (g/mol): 202.32 Numero MDL: MFCD00009462 InChI Key: TUQOTMZNTHZOKS-UHFFFAOYSA-N Sinonimo: tributylphosphine,tri-n-butylphosphine,phosphine, tributyl,tris butyl phosphine,tributylfosfin,tributylfosfin czech,tributyl-phosphane,unii-0o52fjr7wn,tri-n-butyl phosphine,tributyl phosphine tbp PubChem CID: 13831 IUPAC Name: tributylphosphane SMILES: CCCCP(CCCC)CCCC
| Sinonimo | tributylphosphine,tri-n-butylphosphine,phosphine, tributyl,tris butyl phosphine,tributylfosfin,tributylfosfin czech,tributyl-phosphane,unii-0o52fjr7wn,tri-n-butyl phosphine,tributyl phosphine tbp |
|---|---|
| Numero MDL | MFCD00009462 |
| PubChem CID | 13831 |
| Formula molecolare | C12H27P |
| CAS | 998-40-3 |
| Molecular Weight (g/mol) | 202.32 |
| SMILES | CCCCP(CCCC)CCCC |
| IUPAC Name | tributylphosphane |
| InChI Key | TUQOTMZNTHZOKS-UHFFFAOYSA-N |
Thermo Scientific Chemicals Lawesson's Reagent, 97%
CAS: 19172-47-5 Formula molecolare: C14H14O2P2S4 Molecular Weight (g/mol): 404.452 Numero MDL: MFCD00005171 InChI Key: CFHGBZLNZZVTAY-UHFFFAOYSA-N Sinonimo: lawesson's reagent,lawesson reagent,2,4-bis 4-methoxyphenyl-1,3,2,4-dithiadiphosphetane 2,4-disulfide,unii-a4125mq8rx,1,3,2,4-dithiadiphosphetane, 2,4-bis 4-methoxyphenyl-, 2,4-disulfide,2,4-bis 4-methoxyphenyl-2,4-dithioxo-1,3,2,4-dithiadiphosphetane,2,4-bis 4-methoxyphenyl-1,3,2,4-dithiadiphosphetane-2,4-disulfide,2,4-bis 4-methoxyphenyl-1,3-dithia-2,4-diphosphetane 2,4-disulfide,2,4-bis 4-methoxyphenyl-1,3-dithia-2,4-diphosphetane 2,4-disulphide,4-methoxyphenylthiophosphoric cyclic di thioanhydride PubChem CID: 87949 IUPAC Name: 2,4-bis(4-methoxyphenyl)-2,4-bis(sulfanylidene)-1,3,2$l^{5},4$l^{5}-dithiadiphosphetane SMILES: COC1=CC=C(C=C1)P2(=S)SP(=S)(S2)C3=CC=C(C=C3)OC
| Sinonimo | lawesson's reagent,lawesson reagent,2,4-bis 4-methoxyphenyl-1,3,2,4-dithiadiphosphetane 2,4-disulfide,unii-a4125mq8rx,1,3,2,4-dithiadiphosphetane, 2,4-bis 4-methoxyphenyl-, 2,4-disulfide,2,4-bis 4-methoxyphenyl-2,4-dithioxo-1,3,2,4-dithiadiphosphetane,2,4-bis 4-methoxyphenyl-1,3,2,4-dithiadiphosphetane-2,4-disulfide,2,4-bis 4-methoxyphenyl-1,3-dithia-2,4-diphosphetane 2,4-disulfide,2,4-bis 4-methoxyphenyl-1,3-dithia-2,4-diphosphetane 2,4-disulphide,4-methoxyphenylthiophosphoric cyclic di thioanhydride |
|---|---|
| Numero MDL | MFCD00005171 |
| PubChem CID | 87949 |
| Formula molecolare | C14H14O2P2S4 |
| CAS | 19172-47-5 |
| Molecular Weight (g/mol) | 404.452 |
| SMILES | COC1=CC=C(C=C1)P2(=S)SP(=S)(S2)C3=CC=C(C=C3)OC |
| IUPAC Name | 2,4-bis(4-methoxyphenyl)-2,4-bis(sulfanylidene)-1,3,2$l^{5},4$l^{5}-dithiadiphosphetane |
| InChI Key | CFHGBZLNZZVTAY-UHFFFAOYSA-N |
Tri-n-butylphosphine, 95%, AcroSeal™
CAS: 998-40-3 Formula molecolare: C12H27P Molecular Weight (g/mol): 202.32 Numero MDL: MFCD00009462 InChI Key: TUQOTMZNTHZOKS-UHFFFAOYSA-N Sinonimo: tributylphosphine,tri-n-butylphosphine,phosphine, tributyl,tris butyl phosphine,tributylfosfin,tributylfosfin czech,tributyl-phosphane,unii-0o52fjr7wn,tri-n-butyl phosphine,tributyl phosphine tbp PubChem CID: 13831 IUPAC Name: tributylphosphane SMILES: CCCCP(CCCC)CCCC
| Sinonimo | tributylphosphine,tri-n-butylphosphine,phosphine, tributyl,tris butyl phosphine,tributylfosfin,tributylfosfin czech,tributyl-phosphane,unii-0o52fjr7wn,tri-n-butyl phosphine,tributyl phosphine tbp |
|---|---|
| Numero MDL | MFCD00009462 |
| PubChem CID | 13831 |
| Formula molecolare | C12H27P |
| CAS | 998-40-3 |
| Molecular Weight (g/mol) | 202.32 |
| SMILES | CCCCP(CCCC)CCCC |
| IUPAC Name | tributylphosphane |
| InChI Key | TUQOTMZNTHZOKS-UHFFFAOYSA-N |
Tris(hydroxymethyl)phosphine, 95%
CAS: 2767-80-8 Formula molecolare: C3H9O3P Molecular Weight (g/mol): 124.08 Numero MDL: MFCD00055382 InChI Key: JMXMXKRNIYCNRV-UHFFFAOYSA-N Sinonimo: tris hydroxymethyl phosphine,methanol, phosphinidynetris,trimethylolphosphine,phosphinidynetrimethanol,tris methanol phosphine,phosphinidynetrismethanol,unii-y6tg7wf7oq,y6tg7wf7oq,methanol, 1,1',1-phosphinidynetris,methanol, phosphinidynetri-7ci,8ci PubChem CID: 76001 IUPAC Name: bis(hydroxymethyl)phosphanylmethanol SMILES: C(O)P(CO)CO
| Sinonimo | tris hydroxymethyl phosphine,methanol, phosphinidynetris,trimethylolphosphine,phosphinidynetrimethanol,tris methanol phosphine,phosphinidynetrismethanol,unii-y6tg7wf7oq,y6tg7wf7oq,methanol, 1,1',1-phosphinidynetris,methanol, phosphinidynetri-7ci,8ci |
|---|---|
| Numero MDL | MFCD00055382 |
| PubChem CID | 76001 |
| Formula molecolare | C3H9O3P |
| CAS | 2767-80-8 |
| Molecular Weight (g/mol) | 124.08 |
| SMILES | C(O)P(CO)CO |
| IUPAC Name | bis(hydroxymethyl)phosphanylmethanol |
| InChI Key | JMXMXKRNIYCNRV-UHFFFAOYSA-N |
Tetrakis(hydroxymethyl)phosphonium chloride, approx. 75-85% solution in water
CAS: 124-64-1 | C4H12ClO4P | 190.56 g/mol
| Peso formulazione | 190.56 |
|---|---|
| Sinonimo | tetrakis hydroxymethyl phosphonium chloride,thpc,pyroset tkc,retardol c,tetramethylolphosphonium chloride,tetrakis hydroxymethyl phosphanium chloride,unii-58wb2xcf8i,proban cc,tetrakis hydroxymethyl phosphochloride,ccris 317 |
| Numero MDL | MFCD00031687 |
| Pericolo per la salute 1 | GHS Signal Word: Danger |
| Colore | Green-Yellow or Pink |
| Pericolo per la salute 2 | GHS H Statement May be corrosive to metals. Toxic if swallowed. Causes severe skin burns and eye damage. May cause an allergic skin reaction. Suspected of damaging the unborn child. Very toxic to aquatic life with lon |
| Pericolo per la salute 3 | GHS P Statement IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/physician. Wear protective gloves/protective |
| Forma fisica | Solution |
| Molecular Weight (g/mol) | 190.56 |
| SMILES | [Cl-].OC[P+](CO)(CO)CO |
| Densità | 1.3400g/mL |
| InChI Key | AKXUUJCMWZFYMV-UHFFFAOYSA-M |
| Punti di ebollizione | 115.0°C |
| Punto d'infiammabilità | 96°C |
| Gravità specifica | 1.34 |
| Imballaggio | Bottiglia in vetro |
| PubChem CID | 31298 |
| Formula molecolare | C4H12ClO4P |
| Percent Purity | 80.0 to 85.0% |
| Informazioni di solubilità | Solubility in water: soluble. |
| CAS | 7732-18-5 |
| Spettro a infrarossi | Authentic |
| Materiale o nome chimico | Tetrakis(hydroxymethyl)phosphonium chloride |
| IUPAC Name | tetrakis(hydroxymethyl)phosphanium;chloride |
| EINECS Number | 204-707-7 |